(S)-N'1-[2-(5-Methyl-1H-pyrazol-4-yl)-thieno[3,2-d]pyrimidin-4-yl]-3-phenyl-propane-1,2-diamine

ID: ALA3730583

PubChem CID: 89596296

Max Phase: Preclinical

Molecular Formula: C19H20N6S

Molecular Weight: 364.48

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1[nH]ncc1-c1nc(NC[C@@H](N)Cc2ccccc2)c2sccc2n1

Standard InChI:  InChI=1S/C19H20N6S/c1-12-15(11-22-25-12)18-23-16-7-8-26-17(16)19(24-18)21-10-14(20)9-13-5-3-2-4-6-13/h2-8,11,14H,9-10,20H2,1H3,(H,22,25)(H,21,23,24)/t14-/m0/s1

Standard InChI Key:  MCZSYSLIGBKUDS-AWEZNQCLSA-N

Molfile:  

     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
   -1.0028    1.5132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9971   -3.0138    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6168    1.4950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7582    2.9755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2262    3.2840    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9732    1.9832    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9669    0.8708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2067   -0.3050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2935   -3.7700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2878   -5.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2461   -5.8665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5842   -6.0270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5785   -7.5278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8731   -8.2854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8643   -9.7854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5609  -10.5278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2663   -9.7702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2750   -8.2702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  4 10  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 11  2  0
  2 11  1  0
 15 16  1  0
 10 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  1  1
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
M  END

Associated Targets(Human)

PRKCI Tchem Protein kinase C iota (2821 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 364.48Molecular Weight (Monoisotopic): 364.1470AlogP: 3.37#Rotatable Bonds: 6
Polar Surface Area: 92.51Molecular Species: BASEHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.01CX Basic pKa: 9.73CX LogP: 2.65CX LogD: 1.40
Aromatic Rings: 4Heavy Atoms: 26QED Weighted: 0.49Np Likeness Score: -1.61

References

1.  (2013)  Thienopyrimidine inhibitors of atypical protein kinase C, 

Source