The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl{5-[3-({[3-methyl-5-(1-methylethyl)-1-benzothiophen-2-yl]sulfonyl}amino)phenyl]-2H-tetrazol-2-yl}acetate ID: ALA3730791
PubChem CID: 86689192
Max Phase: Preclinical
Molecular Formula: C22H23N5O4S2
Molecular Weight: 485.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)Cn1nnc(-c2cccc(NS(=O)(=O)c3sc4ccc(C(C)C)cc4c3C)c2)n1
Standard InChI: InChI=1S/C22H23N5O4S2/c1-13(2)15-8-9-19-18(11-15)14(3)22(32-19)33(29,30)25-17-7-5-6-16(10-17)21-23-26-27(24-21)12-20(28)31-4/h5-11,13,25H,12H2,1-4H3
Standard InChI Key: DUARPSPASPJACR-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
4.6987 -0.9974 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0872 0.0351 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.2871 0.0482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8236 1.3429 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3243 1.3600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0622 2.6659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5622 2.6800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3243 1.3880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5865 0.0820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0865 0.0680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3490 -1.2106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8309 -1.3370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1541 -2.8018 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8609 -3.5618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7385 -2.5668 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0825 2.3453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6217 1.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6560 0.8780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6319 2.6865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5263 -3.4034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6926 -4.8949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0671 -5.4976 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2001 -6.6902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7260 -5.6061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 2 1 0
2 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 2 0
16 12 1 0
10 12 1 0
4 17 2 0
17 20 1 0
19 18 1 0
18 4 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
17 25 1 0
22 26 1 0
26 27 1 0
26 28 1 0
14 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
30 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.59Molecular Weight (Monoisotopic): 485.1191AlogP: 3.96#Rotatable Bonds: 7Polar Surface Area: 116.07Molecular Species: ACIDHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.27CX Basic pKa: ┄CX LogP: 4.94CX LogD: 4.12Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.39Np Likeness Score: -2.03