N,N-dimethyl-4-[6-(1-methylindol-5-yl)imidazo[1,2-a]pyrazin-3-yl]benzamide

ID: ALA3730806

PubChem CID: 117769473

Max Phase: Preclinical

Molecular Formula: C24H21N5O

Molecular Weight: 395.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)C(=O)c1ccc(-c2cnc3cnc(-c4ccc5c(ccn5C)c4)cn23)cc1

Standard InChI:  InChI=1S/C24H21N5O/c1-27(2)24(30)17-6-4-16(5-7-17)22-13-26-23-14-25-20(15-29(22)23)18-8-9-21-19(12-18)10-11-28(21)3/h4-15H,1-3H3

Standard InChI Key:  UBZTUEWMDPIMEV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6168    1.4950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6116    2.9913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9220    3.7610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9311    0.7345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1749    2.6315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2517    3.8078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8114    5.1995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2965    5.4106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2218    4.2301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6621    2.8384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8593    6.8019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3455    7.0110    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1207    7.7476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7956    8.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0842    6.0653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2233    1.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2188    2.9992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6395    3.4593    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5183    2.2404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6467    1.0527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0129    4.5997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  4  1  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  1 10  1  0
 10 11  2  0
 11 12  1  0
 12 26  2  0
 25 13  2  0
 13 10  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
  9 14  1  0
 17 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
 21 24  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 25  1  0
 27 30  1  0
M  END

Associated Targets(non-human)

Beta-TC6 (562 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 395.47Molecular Weight (Monoisotopic): 395.1746AlogP: 4.26#Rotatable Bonds: 3
Polar Surface Area: 55.43Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.12CX LogP: 2.76CX LogD: 2.76
Aromatic Rings: 5Heavy Atoms: 30QED Weighted: 0.46Np Likeness Score: -1.33

References

1.  (2014)  Nitrogen bicyclic compounds as inhibitors for Scyl1 and Grk5, 

Source