(S)-benzyl 1-(4-((N-(4-(2-chloro-5-methylpyrimidin-4-yl)phenyl)-2,4-dihydroxybenzamido)methyl)benzylamino)-1-oxopropan-2-ylcarbamate

ID: ALA3730908

PubChem CID: 127037501

Max Phase: Preclinical

Molecular Formula: C37H34ClN5O6

Molecular Weight: 680.16

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cnc(Cl)nc1-c1ccc(N(Cc2ccc(CNC(=O)[C@H](C)NC(=O)OCc3ccccc3)cc2)C(=O)c2ccc(O)cc2O)cc1

Standard InChI:  InChI=1S/C37H34ClN5O6/c1-23-19-40-36(38)42-33(23)28-12-14-29(15-13-28)43(35(47)31-17-16-30(44)18-32(31)45)21-26-10-8-25(9-11-26)20-39-34(46)24(2)41-37(48)49-22-27-6-4-3-5-7-27/h3-19,24,44-45H,20-22H2,1-2H3,(H,39,46)(H,41,48)/t24-/m0/s1

Standard InChI Key:  LSEQOPAXXJYNDG-DEOSSOPVSA-N

Molfile:  

     RDKit          2D

 49 53  0  0  0  0  0  0  0  0999 V2000
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3383   -1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003    1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6024    2.6977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8990    0.7455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2003    1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4990    0.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8964   -0.7553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1931   -1.5094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1885   -3.0094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8871   -3.7554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5904   -3.0014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5951   -1.5014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8007    1.4864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0971    0.7319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0919   -0.7681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7903   -1.5136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4939   -0.7591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8824   -5.2561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3875   -1.5257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5799   -6.0002    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5728   -7.5001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8683   -8.2562    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1709   -7.5123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1779   -6.0123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2200   -5.4173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5308   -8.0953    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  -10.3802   -3.0265    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6758   -3.7841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6685   -5.2849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.7181   -3.1895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9640   -6.0425    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -10.6261   -5.8795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9567   -7.5433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.2523   -8.3009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -11.9144   -8.1379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -14.2450   -9.8017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.5405  -10.5592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.5354  -12.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -16.8318  -12.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -18.1335  -12.0683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -18.1387  -10.5683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -16.8423   -9.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  3  8  1  0
  4  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 11 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 13 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 13  1  0
 17 25  1  0
 22 26  1  0
 25 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 25  1  0
 31 32  1  0
 28 33  1  0
 26 34  1  0
 34 35  1  0
 35 36  1  0
 35 37  2  0
 36 38  1  0
 36 39  1  6
 38 40  1  0
 40 41  1  0
 40 42  2  0
 41 43  1  0
 43 44  1  0
 44 45  2  0
 45 46  1  0
 46 47  2  0
 47 48  1  0
 48 49  2  0
 49 44  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3730908

    ---

Associated Targets(Human)

PDK1 Tchem Pyruvate dehydrogenase kinase isoform 1 (2021 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PDK2 Tchem Pyruvate dehydrogenase kinase (522 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 680.16Molecular Weight (Monoisotopic): 679.2198AlogP: 6.29#Rotatable Bonds: 11
Polar Surface Area: 153.98Molecular Species: NEUTRALHBA: 8HBD: 4
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 3
CX Acidic pKa: 7.83CX Basic pKa: 0.27CX LogP: 6.33CX LogD: 6.19
Aromatic Rings: 5Heavy Atoms: 49QED Weighted: 0.12Np Likeness Score: -1.02

References

1.  (2015)  Resorcinol n-aryl amide compounds, for use as pyruvate dehydrogenase kinase inhibitors, 
2. Morrell, J A JA and 5 more authors.  2003-12  AZD7545 is a selective inhibitor of pyruvate dehydrogenase kinase 2.  [PMID:14641019]
3. Meng, Tao T and 10 more authors.  2014-12-11  Discovery and optimization of 4,5-diarylisoxazoles as potent dual inhibitors of pyruvate dehydrogenase kinase and heat shock protein 90.  [PMID:25383915]
4. Moore, Jonathan D and 12 more authors.  2014-12-30  VER-246608, a novel pan-isoform ATP competitive inhibitor of pyruvate dehydrogenase kinase, disrupts Warburg metabolism and induces context-dependent cytostasis in cancer cells.  [PMID:25404640]
5. Narayan, Satya S and 7 more authors.  2019-01-01  ASR352, A potent anticancer agent: Synthesis, preliminary SAR, and biological activities against colorectal cancer bulk, 5-fluorouracil/oxaliplatin resistant and stem cells.  [PMID:30384048]

Source