The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-N-(2-(1H-imidazol-2-yl)ethyl)-2,4-dimethyl-5-((2-oxo-5-(1-phenyl-1H-pyrazol-4-yl)indolin-3-ylidene)methyl)-1H-pyrrole-3-carboxamide ID: ALA3731094
PubChem CID: 117622409
Max Phase: Preclinical
Molecular Formula: C30H27N7O2
Molecular Weight: 517.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1[nH]c(/C=C2\C(=O)Nc3ccc(-c4cnn(-c5ccccc5)c4)cc32)c(C)c1C(=O)NCCc1ncc[nH]1
Standard InChI: InChI=1S/C30H27N7O2/c1-18-26(35-19(2)28(18)30(39)33-11-10-27-31-12-13-32-27)15-24-23-14-20(8-9-25(23)36-29(24)38)21-16-34-37(17-21)22-6-4-3-5-7-22/h3-9,12-17,35H,10-11H2,1-2H3,(H,31,32)(H,33,39)(H,36,38)/b24-15-
Standard InChI Key: QIKLSDUUBBKGCY-IWIPYMOSSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7889 0.0269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1812 2.6271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6500 2.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2449 4.2986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7359 4.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0412 2.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7388 1.9224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6168 1.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7580 2.9756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2259 3.2843 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.9730 1.9836 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9669 0.8711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8393 4.6540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0560 5.9274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7704 7.2464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2699 7.2872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.0549 6.0091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.3406 4.6901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6433 5.3370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1353 2.1736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7457 5.2420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3820 6.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2119 4.9213 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2234 6.0300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6896 5.7093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7011 6.8180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1775 6.6383 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7937 8.0059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6835 9.0146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3811 8.2704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
8 10 2 0
9 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 2 0
21 17 1 0
1 17 1 0
19 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
13 28 1 0
15 29 1 0
14 30 1 0
30 31 2 0
30 32 1 0
33 32 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 2 0
38 39 1 0
39 35 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 517.59Molecular Weight (Monoisotopic): 517.2226AlogP: 4.67#Rotatable Bonds: 7Polar Surface Area: 120.49Molecular Species: NEUTRALHBA: 5HBD: 4#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.17CX Basic pKa: 6.53CX LogP: 3.70CX LogD: 3.65Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.23Np Likeness Score: -1.32
References 1. (2014) 3-(aryl or heteroaryl) methyleneindolin-2-one derivatives as inhibitors of cancer stem cell pathway kinases for the treatment of cancer, 2. (2019) 3-(aryl or heteroaryl) methyleneindolin-2-one derivatives as inhibitors of cancer stem cell pathway kinases for the treatment of cancer,