3-(difluoromethoxy)-5-[2-[3-methylpyrrolidin-1-yll-6-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]pyrimidin-4-yl]pyridin-2-amine

ID: ALA3731156

PubChem CID: 117688587

Max Phase: Preclinical

Molecular Formula: C20H24F2N6O2

Molecular Weight: 418.45

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1CCN(c2nc(-c3cnc(N)c(OC(F)F)c3)cc(N3C[C@@H]4C[C@H]3CO4)n2)C1

Standard InChI:  InChI=1S/C20H24F2N6O2/c1-11-2-3-27(8-11)20-25-15(12-4-16(30-19(21)22)18(23)24-7-12)6-17(26-20)28-9-14-5-13(28)10-29-14/h4,6-7,11,13-14,19H,2-3,5,8-10H2,1H3,(H2,23,24)/t11?,13-,14-/m0/s1

Standard InChI Key:  YNXQMEOOIAVACB-VNXPTHQBSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    4.8544   -1.3177    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5549   -0.5685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5540    0.9316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8527    1.6823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1522    0.9330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1530   -0.5670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1926   -1.1664    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2550    1.6833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9552    0.9346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3445    1.6863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3415    3.1859    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9583    3.9346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2566    3.1833    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4499    1.6869    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4469    3.1877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6137    0.9247    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9598    5.4354    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4846    3.7904    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.4063    3.7853    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9011    1.6863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1884    0.9247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1884   -0.5440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9011   -1.2692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6137   -0.5440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9011    2.6863    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9011   -2.2692    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4632    0.1632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2515    6.2984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2158    7.7237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7158    7.7198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1756    6.2921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4236    8.6888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  3  8  1  0
  5 14  1  0
 14 15  1  0
 10 16  1  0
 12 17  1  0
 15 18  1  0
 15 19  1  0
 16 20  1  0
 16 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 20 25  1  6
 23 26  1  6
 20 27  1  0
 23 27  1  0
 17 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 17  1  0
 30 32  1  0
M  END

Associated Targets(Human)

MAP3K12 Tchem Mitogen-activated protein kinase kinase kinase 12 (1076 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 418.45Molecular Weight (Monoisotopic): 418.1929AlogP: 2.55#Rotatable Bonds: 5
Polar Surface Area: 89.63Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.24CX LogP: 3.45CX LogD: 3.42
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.79Np Likeness Score: -0.97

References

1.  (2014)  Biheteroaryl compounds and uses thereof, 
2.  (2014)  Biheteroaryl compounds and uses thereof, 

Source