5-Fluoro-3-methyl-N-[3-(1H-tetrazol-5-yl)phenyl]-1-benzothiophene-2-sulfonamide

ID: ALA3731503

PubChem CID: 56941309

Max Phase: Preclinical

Molecular Formula: C16H12FN5O2S2

Molecular Weight: 389.44

Molecule Type: Small molecule

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(S(=O)(=O)Nc2cccc(-c3nnn[nH]3)c2)sc2ccc(F)cc12

Standard InChI:  InChI=1S/C16H12FN5O2S2/c1-9-13-8-11(17)5-6-14(13)25-16(9)26(23,24)20-12-4-2-3-10(7-12)15-18-21-22-19-15/h2-8,20H,1H3,(H,18,19,21,22)

Standard InChI Key:  FVGLWSPCUSNJOM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
   -0.4916   -3.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383    1.3500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5524   -4.4208    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.7524   -4.4204    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1529   -5.4597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8028   -5.7210    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5532   -7.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8059   -8.3214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5586   -9.6189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0586   -9.6159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8059   -8.3153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0533   -7.0178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3067   -8.3122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1709   -9.5226    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5958   -9.0539    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5904   -7.5539    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1621   -7.0956    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  8 10  1  0
 10 11  2  0
 11  2  1  0
 11  5  1  0
  3 12  1  0
 12 13  2  0
 12 14  2  0
 12 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 20 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 22  1  0
M  END

Associated Targets(Human)

PFKFB4 Tchem 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 4 (37 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 389.44Molecular Weight (Monoisotopic): 389.0416AlogP: 3.33#Rotatable Bonds: 4
Polar Surface Area: 100.63Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.28CX Basic pKa: CX LogP: 3.44CX LogD: 1.09
Aromatic Rings: 4Heavy Atoms: 26QED Weighted: 0.56Np Likeness Score: -2.34

References

1.  (2012)  New compounds, 
2.  (2016)  Sulfonamide compounds,