The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Methoxy-N-{4-[4-((R)-pyrrolidin-3-ylamino)-thieno[3,2-d]pyrimidin-2-yl]-pyridin-2-yl}-benzamide ID: ALA3731535
PubChem CID: 89596374
Max Phase: Preclinical
Molecular Formula: C23H22N6O2S
Molecular Weight: 446.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(C(=O)Nc2cc(-c3nc(N[C@@H]4CCNC4)c4sccc4n3)ccn2)c1
Standard InChI: InChI=1S/C23H22N6O2S/c1-31-17-4-2-3-15(11-17)23(30)28-19-12-14(5-9-25-19)21-27-18-7-10-32-20(18)22(29-21)26-16-6-8-24-13-16/h2-5,7,9-12,16,24H,6,8,13H2,1H3,(H,25,28,30)(H,26,27,29)/t16-/m1/s1
Standard InChI Key: HAVCMPJFCGPNOC-MRXNPFEDSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
-1.0028 -1.5132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9971 3.0138 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-6.2151 -1.4892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6204 -2.9950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9144 -0.7421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9211 -3.7421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2935 3.7700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2185 -2.9892 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6168 -1.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4279 5.2511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8944 5.5664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6474 4.2692 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6464 3.1521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9214 -5.2429 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6222 -5.9944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6225 -7.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5827 -5.3949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3252 -8.2482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3285 -9.7482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6292 -10.4953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9266 -9.7424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9232 -8.2424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2295 -10.4873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.2666 -9.8835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 1 1 0
6 14 2 0
5 4 1 0
8 16 1 0
4 3 2 0
17 11 2 0
3 8 1 0
15 12 1 0
16 5 2 0
14 2 1 0
1 7 2 0
12 10 2 0
13 2 1 1
10 17 1 0
9 15 2 0
14 3 1 0
11 9 1 0
7 17 1 0
7 6 1 0
13 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 13 1 0
12 22 1 0
22 23 1 0
23 24 1 0
23 25 2 0
24 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 24 1 0
29 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.54Molecular Weight (Monoisotopic): 446.1525AlogP: 3.79#Rotatable Bonds: 6Polar Surface Area: 101.06Molecular Species: BASEHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.31CX LogP: 3.64CX LogD: 0.86Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.41Np Likeness Score: -1.73
References 1. (2013) Thienopyrimidine inhibitors of atypical protein kinase C,