4'-Methoxy-N-[3-(1H-tetrazol-5-yl)phenyl]biphenyl-4-sulfonamide

ID: ALA3731572

PubChem CID: 56942168

Max Phase: Preclinical

Molecular Formula: C20H17N5O3S

Molecular Weight: 407.45

Molecule Type: Small molecule

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2ccc(S(=O)(=O)Nc3cccc(-c4nnn[nH]4)c3)cc2)cc1

Standard InChI:  InChI=1S/C20H17N5O3S/c1-28-18-9-5-14(6-10-18)15-7-11-19(12-8-15)29(26,27)23-17-4-2-3-16(13-17)20-21-24-25-22-20/h2-13,23H,1H3,(H,21,22,24,25)

Standard InChI Key:  ZHYZXZSYODRADO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    2.5956   -2.7031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5987    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6012    3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9015    3.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1993    2.9963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1969    1.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8967    0.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5002    3.7446    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5383    3.1426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5407    4.3425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5036    5.2455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8045    5.9938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8101    7.4938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1118    8.2391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.4081    7.4844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.4027    5.9844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1009    5.2391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6996    5.2293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.0543    5.8433    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -14.0521    4.7233    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -13.2954    3.4282    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -11.8298    3.7478    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  6  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 12 15  1  0
 15 16  2  0
 15 17  2  0
 15 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 23 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 25  1  0
M  END

Associated Targets(Human)

PFKFB4 Tchem 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 4 (37 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 407.45Molecular Weight (Monoisotopic): 407.1052AlogP: 3.34#Rotatable Bonds: 6
Polar Surface Area: 109.86Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.28CX Basic pKa: CX LogP: 3.23CX LogD: 1.50
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.51Np Likeness Score: -1.73

References

1.  (2012)  New compounds, 
2.  (2016)  Sulfonamide compounds,