The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4'-Methoxy-N-[3-(1H-tetrazol-5-yl)phenyl]biphenyl-4-sulfonamide ID: ALA3731572
PubChem CID: 56942168
Max Phase: Preclinical
Molecular Formula: C20H17N5O3S
Molecular Weight: 407.45
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2ccc(S(=O)(=O)Nc3cccc(-c4nnn[nH]4)c3)cc2)cc1
Standard InChI: InChI=1S/C20H17N5O3S/c1-28-18-9-5-14(6-10-18)15-7-11-19(12-8-15)29(26,27)23-17-4-2-3-16(13-17)20-21-24-25-22-20/h2-13,23H,1H3,(H,21,22,24,25)
Standard InChI Key: ZHYZXZSYODRADO-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
2.5956 -2.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6012 3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9015 3.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1993 2.9963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1969 1.4963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8967 0.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5002 3.7446 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-7.5383 3.1426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.5407 4.3425 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.5036 5.2455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.8045 5.9938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8101 7.4938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1118 8.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.4081 7.4844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.4027 5.9844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1009 5.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6996 5.2293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.0543 5.8433 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-14.0521 4.7233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-13.2954 3.4282 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-11.8298 3.7478 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
6 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
12 15 1 0
15 16 2 0
15 17 2 0
15 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
23 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 25 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 407.45Molecular Weight (Monoisotopic): 407.1052AlogP: 3.34#Rotatable Bonds: 6Polar Surface Area: 109.86Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.28CX Basic pKa: ┄CX LogP: 3.23CX LogD: 1.50Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.51Np Likeness Score: -1.73
References 1. (2012) New compounds, 2. (2016) Sulfonamide compounds,