5-Methyl-N-[3-(1H-tetrazol-5-yl)phenyl]-1-benzothiophene-2-sulfonamide

ID: ALA3731894

PubChem CID: 56941168

Max Phase: Preclinical

Molecular Formula: C16H13N5O2S2

Molecular Weight: 371.45

Molecule Type: Small molecule

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc2sc(S(=O)(=O)Nc3cccc(-c4nnn[nH]4)c3)cc2c1

Standard InChI:  InChI=1S/C16H13N5O2S2/c1-10-5-6-14-12(7-10)9-15(24-14)25(22,23)19-13-4-2-3-11(8-13)16-17-20-21-18-16/h2-9,19H,1H3,(H,17,18,20,21)

Standard InChI Key:  JZRLNPGMMUVFAO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 25 28  0  0  0  0  0  0  0  0999 V2000
    2.3383   -1.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7248    1.2135    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6065    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7248   -1.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1047    0.0000    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7044   -1.0395    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3047   -0.0006    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8559    1.2992    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3568    1.2992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1095    2.5967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.6095    2.5937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3569    1.2931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.6042   -0.0044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1042   -0.0014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3519   -1.3056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.8323   -1.4489    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -12.1388   -2.9172    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -10.8371   -3.6625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -9.7260   -2.6548    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  9 10  2  0
 10  2  1  0
  7 11  1  0
 11 12  2  0
 11 13  2  0
 11 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 19 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 21  1  0
M  END

Associated Targets(Human)

PFKFB4 Tchem 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 4 (37 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 371.45Molecular Weight (Monoisotopic): 371.0511AlogP: 3.19#Rotatable Bonds: 4
Polar Surface Area: 100.63Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.28CX Basic pKa: CX LogP: 3.30CX LogD: 0.91
Aromatic Rings: 4Heavy Atoms: 25QED Weighted: 0.57Np Likeness Score: -2.35

References

1.  (2012)  New compounds, 
2.  (2016)  Sulfonamide compounds,