The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((cis)-3-azabicyclo[3.1.0]hexan-6-yl)-2,4-dimethyl-5-((Z)-(2-oxo-5-(1-phenyl-1H-pyrazol-4-yl)indolin-3-ylidene)methyl)-1H-pyrrole-3-carboxamide dihydrochloride ID: ALA3732058
PubChem CID: 127036536
Max Phase: Preclinical
Molecular Formula: C30H30Cl2N6O2
Molecular Weight: 504.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1[nH]c(/C=C2\C(=O)Nc3ccc(-c4cnn(-c5ccccc5)c4)cc32)c(C)c1C(=O)N[C@H]1[C@@H]2CNC[C@@H]21.Cl.Cl
Standard InChI: InChI=1S/C30H28N6O2.2ClH/c1-16-26(33-17(2)27(16)30(38)35-28-23-13-31-14-24(23)28)11-22-21-10-18(8-9-25(21)34-29(22)37)19-12-32-36(15-19)20-6-4-3-5-7-20;;/h3-12,15,23-24,28,31,33H,13-14H2,1-2H3,(H,34,37)(H,35,38);2*1H/b22-11-;;/t23-,24+,28+;;
Standard InChI Key: SISYAXFBGUBROU-OBUWGQEBSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
13.9821 3.4164 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7889 0.0269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1812 2.6271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6500 2.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2449 4.2986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7359 4.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0412 2.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7388 1.9224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6168 1.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7580 2.9756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2259 3.2843 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.9730 1.9836 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9669 0.8711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8393 4.6540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0560 5.9274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7704 7.2464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2699 7.2872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.0549 6.0091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.3406 4.6901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6433 5.3370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1353 2.1736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7457 5.2420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3820 6.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2119 4.9213 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2234 6.0300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8246 7.3222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5599 5.7592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4821 6.7832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0653 8.0761 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7468 8.3461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8012 7.1070 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.2464 6.7088 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
16.4821 3.4164 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 6 1 0
9 11 2 0
10 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 13 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 22 2 0
22 18 1 0
2 18 1 0
20 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
14 29 1 0
16 30 1 0
15 31 1 0
31 32 2 0
31 33 1 0
34 33 1 6
36 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 35 1 0
35 40 1 6
36 41 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 504.59Molecular Weight (Monoisotopic): 504.2274AlogP: 3.92#Rotatable Bonds: 5Polar Surface Area: 103.84Molecular Species: BASEHBA: 5HBD: 4#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.33CX Basic pKa: 10.66CX LogP: 2.61CX LogD: 0.02Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.31Np Likeness Score: -0.87
References 1. (2014) 3-(aryl or heteroaryl) methyleneindolin-2-one derivatives as inhibitors of cancer stem cell pathway kinases for the treatment of cancer, 2. (2019) 3-(aryl or heteroaryl) methyleneindolin-2-one derivatives as inhibitors of cancer stem cell pathway kinases for the treatment of cancer,