5-Chloro-3-methyl-N-[3-(1,3-oxazol-5-yl)phenyl]-1-benzothiophene-2-sulfonamide

ID: ALA3732213

PubChem CID: 56942777

Max Phase: Preclinical

Molecular Formula: C18H13ClN2O3S2

Molecular Weight: 404.90

Molecule Type: Small molecule

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(S(=O)(=O)Nc2cccc(-c3cnco3)c2)sc2ccc(Cl)cc12

Standard InChI:  InChI=1S/C18H13ClN2O3S2/c1-11-15-8-13(19)5-6-17(15)25-18(11)26(22,23)21-14-4-2-3-12(7-14)16-9-20-10-24-16/h2-10,21H,1H3

Standard InChI Key:  AWNGZAAXPFWDAQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
    4.6987   -0.9974    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0872    0.0351    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.2871    0.0482    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8236    1.3429    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3243    1.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0622    2.6659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5622    2.6800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3243    1.3880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5865    0.0820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0865    0.0680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0907   -2.3426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3560   -1.3452    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.3490   -1.2106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8309   -1.3370    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1541   -2.8018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8609   -3.5618    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7385   -2.5668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  2  1  0
  2  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  4 12  1  0
 12 15  1  0
 14 13  1  0
 13  4  2  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 13 20  1  0
 18 21  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 22  2  0
 10 22  1  0
M  END

Associated Targets(Human)

PFKFB3 Tchem fructose-2,6-bisphosphatase 3/4 (29 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 404.90Molecular Weight (Monoisotopic): 404.0056AlogP: 5.32#Rotatable Bonds: 4
Polar Surface Area: 72.20Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 6.28CX Basic pKa: 0.76CX LogP: 4.13CX LogD: 3.38
Aromatic Rings: 4Heavy Atoms: 26QED Weighted: 0.50Np Likeness Score: -1.77

References

1.  (2012)  New compounds, 

Source