Methyl 3-({[3-methyl-5-(1-methylethyl)-1-benzofuran-2-yl]sulfonyl}amino)benzoate

ID: ALA3732402

PubChem CID: 66799985

Max Phase: Preclinical

Molecular Formula: C20H21NO5S

Molecular Weight: 387.46

Molecule Type: Small molecule

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)c1cccc(NS(=O)(=O)c2oc3ccc(C(C)C)cc3c2C)c1

Standard InChI:  InChI=1S/C20H21NO5S/c1-12(2)14-8-9-18-17(11-14)13(3)20(26-18)27(23,24)21-16-7-5-6-15(10-16)19(22)25-4/h5-12,21H,1-4H3

Standard InChI Key:  BMCWFIMDGCVQKS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
    4.6750    1.0813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0872    0.0351    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.2871    0.0494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3539   -1.2384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1214   -2.5273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6212   -2.5071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3537   -1.1981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5864    0.0907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0865    0.0706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8532   -1.2555    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0907   -2.3426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6187   -1.4919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6251   -2.6919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6549   -0.8867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3166    1.4019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5470    2.6904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5164    1.4201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1308    3.7388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  4 10  1  0
 10  2  1  0
  2 11  1  0
 11 12  1  0
 12 15  1  0
 14 13  1  0
 13 11  2  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 13 20  1  0
 18 21  1  0
 21 22  1  0
 21 23  1  0
  8 24  1  0
 24 25  1  0
 24 26  2  0
 25 27  1  0
M  END

Associated Targets(Human)

PFKFB3 Tchem fructose-2,6-bisphosphatase 3/4 (29 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 387.46Molecular Weight (Monoisotopic): 387.1140AlogP: 4.45#Rotatable Bonds: 5
Polar Surface Area: 85.61Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 5.58CX Basic pKa: CX LogP: 4.47CX LogD: 3.58
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.65Np Likeness Score: -0.84

References

1.  (2012)  New compounds, 

Source