Methyl 5-{[(5-chloro-3-methyl-1-benzothiophen-2-yl)sulfonyl]amino}-2-hydroxybenzoate

ID: ALA3732576

PubChem CID: 66799725

Max Phase: Preclinical

Molecular Formula: C17H14ClNO5S2

Molecular Weight: 411.89

Molecule Type: Small molecule

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)c1cc(NS(=O)(=O)c2sc3ccc(Cl)cc3c2C)ccc1O

Standard InChI:  InChI=1S/C17H14ClNO5S2/c1-9-12-7-10(18)3-6-15(12)25-17(9)26(22,23)19-11-4-5-14(20)13(8-11)16(21)24-2/h3-8,19-20H,1-2H3

Standard InChI Key:  QJJLJVCUQPLRDB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
    4.6987   -0.9974    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0872    0.0351    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.2871    0.0482    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8236    1.3429    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3243    1.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0622    2.6659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5622    2.6800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3243    1.3880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5865    0.0820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0865    0.0680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0907   -2.3426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2977    3.9882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5333    5.2798    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4976    4.0015    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1215    6.3258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3560   -1.3452    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   10.5242    1.3992    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  2  1  0
  2  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  4 12  1  0
 12 15  1  0
 14 13  1  0
 13  4  2  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 13 20  1  0
  8 21  1  0
 21 22  1  0
 21 23  2  0
 22 24  1  0
 18 25  1  0
  9 26  1  0
M  END

Associated Targets(Human)

PFKFB3 Tchem fructose-2,6-bisphosphatase 3/4 (29 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 411.89Molecular Weight (Monoisotopic): 411.0002AlogP: 4.16#Rotatable Bonds: 4
Polar Surface Area: 92.70Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 6.37CX Basic pKa: CX LogP: 4.97CX LogD: 4.24
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.50Np Likeness Score: -1.28

References

1.  (2012)  New compounds, 

Source