N-((1H-benzo[d]imidazol-2-yl)methyl)-5-chloro-N-(4-(dimethylcarbamoyl)phenyl)-2,4-dihydroxybenzamide

ID: ALA3732681

PubChem CID: 127037322

Max Phase: Preclinical

Molecular Formula: C24H21ClN4O4

Molecular Weight: 464.91

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)C(=O)c1ccc(N(Cc2nc3ccccc3[nH]2)C(=O)c2cc(Cl)c(O)cc2O)cc1

Standard InChI:  InChI=1S/C24H21ClN4O4/c1-28(2)23(32)14-7-9-15(10-8-14)29(13-22-26-18-5-3-4-6-19(18)27-22)24(33)16-11-17(25)21(31)12-20(16)30/h3-12,30-31H,13H2,1-2H3,(H,26,27)

Standard InChI Key:  NVMRMTUKPWDCRL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    8.6352   -5.1247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3749   -3.8197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6146   -2.5267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1146   -2.5384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3749   -3.8435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1352   -5.1365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2434   -6.1591    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2064   -1.4827    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3513   -1.2462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9413   -0.2013    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8506   -1.2602    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0872    0.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1127   -2.5671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6127   -2.5837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8771   -3.8909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6413   -5.1816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1412   -5.1651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8769   -3.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5434   -6.1805    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.9079   -6.4910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6744   -7.7813    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7080   -6.5063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0880   -8.8283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8743   -7.7661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  3  8  1  0
  4  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 11 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
  6 20  1  0
 17 21  1  0
 21 22  1  0
 21 23  2  0
 22 24  1  0
 22 25  1  0
 13 26  1  0
 26 29  1  0
 28 27  1  0
 27 13  2  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3732681

    ---

Associated Targets(Human)

PDK1 Tchem Pyruvate dehydrogenase kinase isoform 1 (2021 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 464.91Molecular Weight (Monoisotopic): 464.1251AlogP: 4.18#Rotatable Bonds: 5
Polar Surface Area: 109.76Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 6.99CX Basic pKa: 5.03CX LogP: 3.31CX LogD: 2.72
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.41Np Likeness Score: -1.45

References

1.  (2015)  Resorcinol n-aryl amide compounds, for use as pyruvate dehydrogenase kinase inhibitors, 

Source