The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((1H-benzo[d]imidazol-2-yl)methyl)-5-chloro-N-(4-(dimethylcarbamoyl)phenyl)-2,4-dihydroxybenzamide ID: ALA3732681
PubChem CID: 127037322
Max Phase: Preclinical
Molecular Formula: C24H21ClN4O4
Molecular Weight: 464.91
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)C(=O)c1ccc(N(Cc2nc3ccccc3[nH]2)C(=O)c2cc(Cl)c(O)cc2O)cc1
Standard InChI: InChI=1S/C24H21ClN4O4/c1-28(2)23(32)14-7-9-15(10-8-14)29(13-22-26-18-5-3-4-6-19(18)27-22)24(33)16-11-17(25)21(31)12-20(16)30/h3-12,30-31H,13H2,1-2H3,(H,26,27)
Standard InChI Key: NVMRMTUKPWDCRL-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
8.6352 -5.1247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3749 -3.8197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6146 -2.5267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1146 -2.5384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3749 -3.8435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1352 -5.1365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2434 -6.1591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2064 -1.4827 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3513 -1.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9413 -0.2013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8506 -1.2602 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0872 0.0320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1127 -2.5671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6127 -2.5837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8771 -3.8909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6413 -5.1816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1412 -5.1651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8769 -3.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5434 -6.1805 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.9079 -6.4910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6744 -7.7813 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7080 -6.5063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0880 -8.8283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8743 -7.7661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
3 8 1 0
4 9 1 0
9 10 2 0
9 11 1 0
11 12 1 0
12 13 1 0
11 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
6 20 1 0
17 21 1 0
21 22 1 0
21 23 2 0
22 24 1 0
22 25 1 0
13 26 1 0
26 29 1 0
28 27 1 0
27 13 2 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.91Molecular Weight (Monoisotopic): 464.1251AlogP: 4.18#Rotatable Bonds: 5Polar Surface Area: 109.76Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.99CX Basic pKa: 5.03CX LogP: 3.31CX LogD: 2.72Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.41Np Likeness Score: -1.45
References 1. (2015) Resorcinol n-aryl amide compounds, for use as pyruvate dehydrogenase kinase inhibitors,