5-(4-Methylphenyl)-N-[3-(1H-tetrazol-5-yl)phenyl]thiophene-2-sulfonamide

ID: ALA3732792

PubChem CID: 56941006

Max Phase: Preclinical

Molecular Formula: C18H15N5O2S2

Molecular Weight: 397.49

Molecule Type: Small molecule

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(-c2ccc(S(=O)(=O)Nc3cccc(-c4nnn[nH]4)c3)s2)cc1

Standard InChI:  InChI=1S/C18H15N5O2S2/c1-12-5-7-13(8-6-12)16-9-10-17(26-16)27(24,25)21-15-4-2-3-14(11-15)18-19-22-23-20-18/h2-11,21H,1H3,(H,19,20,22,23)

Standard InChI Key:  LPPVVGXUJRZVRB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
    2.3383   -1.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5987    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7390    2.9810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2067    3.2905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9546    1.9903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9492    0.8772    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4444    1.8313    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9304    0.7342    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6376    1.7034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3293    3.0436    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8216    2.8843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.7078    4.0946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.1990    3.9324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.8041    2.5599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.9180    1.3496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.4268    1.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.5235   -0.0236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9803   -0.3232    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -13.1293   -1.8157    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -11.7558   -2.4187    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -10.7580   -1.2988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  5  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  8  1  0
 11 13  1  0
 13 14  2  0
 13 15  2  0
 13 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 21 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 23  1  0
M  END

Associated Targets(Human)

PFKFB4 Tchem 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 4 (37 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PFKFB3 Tchem fructose-2,6-bisphosphatase 3/4 (29 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 397.49Molecular Weight (Monoisotopic): 397.0667AlogP: 3.70#Rotatable Bonds: 5
Polar Surface Area: 100.63Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.28CX Basic pKa: CX LogP: 3.85CX LogD: 1.49
Aromatic Rings: 4Heavy Atoms: 27QED Weighted: 0.53Np Likeness Score: -2.24

References

1.  (2012)  New compounds, 
2.  (2016)  Sulfonamide compounds,