The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-[2-cyclopropyl-6-[(1S,4S)-5-(2-methoxyethyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyrimidin-4-yl]-3-(trifluoromethoxy)pyridin-2-amine ID: ALA3732927
PubChem CID: 117688683
Max Phase: Preclinical
Molecular Formula: C21H25F3N6O2
Molecular Weight: 450.47
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCN1C[C@@H]2C[C@H]1CN2c1cc(-c2cnc(N)c(OC(F)(F)F)c2)nc(C2CC2)n1
Standard InChI: InChI=1S/C21H25F3N6O2/c1-31-5-4-29-10-15-7-14(29)11-30(15)18-8-16(27-20(28-18)12-2-3-12)13-6-17(19(25)26-9-13)32-21(22,23)24/h6,8-9,12,14-15H,2-5,7,10-11H2,1H3,(H2,25,26)/t14-,15-/m0/s1
Standard InChI Key: GJWBJCCFORGZSV-GJZGRUSLSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
8.1805 7.6666 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4699 6.3456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9705 6.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1818 7.5764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8924 8.8974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3918 8.9425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9603 9.9993 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2574 4.9799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0441 3.7027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3324 2.3862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8320 2.3402 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0453 3.6173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7580 4.9372 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1007 10.1724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6006 10.1252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9871 1.1802 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5452 3.5746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3581 2.7924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3178 4.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3927 0.0086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0646 -1.3611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7530 -1.3180 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4164 0.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7014 1.2233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7611 -2.4108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3142 -3.8435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3308 -4.9476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9734 -6.0932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3931 0.0372 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.2778 -0.3786 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.9519 -0.5513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9675 11.1446 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.0339 9.0674 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.4012 10.0868 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
3 8 1 0
5 14 1 0
14 15 1 0
10 16 1 0
12 17 1 0
18 17 1 0
19 18 1 0
17 19 1 0
16 20 1 0
16 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
22 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
20 29 1 6
23 30 1 6
20 31 1 0
23 31 1 0
15 32 1 0
15 33 1 0
15 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 450.47Molecular Weight (Monoisotopic): 450.1991AlogP: 2.81#Rotatable Bonds: 7Polar Surface Area: 89.63Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.75CX LogP: 4.06CX LogD: 3.55Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.69Np Likeness Score: -0.87
References 1. (2014) Biheteroaryl compounds and uses thereof,