5-[2-cyclopropyl-6-[(1S,4S)-5-(2-methoxyethyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyrimidin-4-yl]-3-(trifluoromethoxy)pyridin-2-amine

ID: ALA3732927

PubChem CID: 117688683

Max Phase: Preclinical

Molecular Formula: C21H25F3N6O2

Molecular Weight: 450.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COCCN1C[C@@H]2C[C@H]1CN2c1cc(-c2cnc(N)c(OC(F)(F)F)c2)nc(C2CC2)n1

Standard InChI:  InChI=1S/C21H25F3N6O2/c1-31-5-4-29-10-15-7-14(29)11-30(15)18-8-16(27-20(28-18)12-2-3-12)13-6-17(19(25)26-9-13)32-21(22,23)24/h6,8-9,12,14-15H,2-5,7,10-11H2,1H3,(H2,25,26)/t14-,15-/m0/s1

Standard InChI Key:  GJWBJCCFORGZSV-GJZGRUSLSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    8.1805    7.6666    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4699    6.3456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9705    6.3004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1818    7.5764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8924    8.8974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3918    8.9425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9603    9.9993    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2574    4.9799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0441    3.7027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3324    2.3862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8320    2.3402    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0453    3.6173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7580    4.9372    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1007   10.1724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6006   10.1252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9871    1.1802    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5452    3.5746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3581    2.7924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3178    4.2919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3927    0.0086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0646   -1.3611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7530   -1.3180    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4164    0.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7014    1.2233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7611   -2.4108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3142   -3.8435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3308   -4.9476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9734   -6.0932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3931    0.0372    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2778   -0.3786    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9519   -0.5513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9675   11.1446    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.0339    9.0674    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.4012   10.0868    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  3  8  1  0
  5 14  1  0
 14 15  1  0
 10 16  1  0
 12 17  1  0
 18 17  1  0
 19 18  1  0
 17 19  1  0
 16 20  1  0
 16 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 22 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 20 29  1  6
 23 30  1  6
 20 31  1  0
 23 31  1  0
 15 32  1  0
 15 33  1  0
 15 34  1  0
M  END

Associated Targets(Human)

MAP3K12 Tchem Mitogen-activated protein kinase kinase kinase 12 (1076 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 450.47Molecular Weight (Monoisotopic): 450.1991AlogP: 2.81#Rotatable Bonds: 7
Polar Surface Area: 89.63Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.75CX LogP: 4.06CX LogD: 3.55
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.69Np Likeness Score: -0.87

References

1.  (2014)  Biheteroaryl compounds and uses thereof, 

Source