N-(4-(N-benzyl-2,4-dihydroxybenzamido)phenyl)-1H-indole-2-carboxamide

ID: ALA3733038

PubChem CID: 127036122

Max Phase: Preclinical

Molecular Formula: C29H23N3O4

Molecular Weight: 477.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(N(Cc2ccccc2)C(=O)c2ccc(O)cc2O)cc1)c1cc2ccccc2[nH]1

Standard InChI:  InChI=1S/C29H23N3O4/c33-23-14-15-24(27(34)17-23)29(36)32(18-19-6-2-1-3-7-19)22-12-10-21(11-13-22)30-28(35)26-16-20-8-4-5-9-25(20)31-26/h1-17,31,33-34H,18H2,(H,30,35)

Standard InChI Key:  QUJATYWVTVFYGI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
    9.2815    3.9829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7813    4.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5500    2.7164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8188    1.4067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3189    1.3851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5503    2.6732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6666    5.0134    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7498    2.7338    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5853    0.1163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7852    0.1315    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8519   -1.1931    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6183   -2.4835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8849   -3.7929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3512   -1.2122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6160   -2.5196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1161   -2.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3513   -1.2462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0866    0.0613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5865    0.0783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6490   -5.0837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9133   -6.3909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4134   -6.4073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6492   -5.1166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3849   -3.8094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8506   -1.2602    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0872    0.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6772    1.0770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  3  8  1  0
  4  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 11 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 13 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 13  1  0
 17 25  1  0
 25 26  1  0
 26 27  2  0
 26 28  1  0
 28 29  1  0
 29 32  1  0
 31 30  1  0
 30 28  2  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3733038

    ---

Associated Targets(Human)

PDK1 Tchem Pyruvate dehydrogenase kinase isoform 1 (2021 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 477.52Molecular Weight (Monoisotopic): 477.1689AlogP: 5.68#Rotatable Bonds: 6
Polar Surface Area: 105.66Molecular Species: NEUTRALHBA: 4HBD: 4
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.83CX Basic pKa: CX LogP: 5.16CX LogD: 5.02
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.25Np Likeness Score: -1.11

References

1.  (2015)  Resorcinol n-aryl amide compounds, for use as pyruvate dehydrogenase kinase inhibitors, 

Source