The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-[2-cyclopropyl-6-[3-(oxetan-3-yl)-3-azabicyclo[3.3.1]nonan-7-yl]pyrimidin-4-yl]-3-(difluoromethoxy)pyridin-2-amine ID: ALA3733108
PubChem CID: 117688861
Max Phase: Preclinical
Molecular Formula: C24H29F2N5O2
Molecular Weight: 457.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ncc(-c2cc(C3CC4CC(C3)CN(C3COC3)C4)nc(C3CC3)n2)cc1OC(F)F
Standard InChI: InChI=1S/C24H29F2N5O2/c25-24(26)33-21-6-17(8-28-22(21)27)20-7-19(29-23(30-20)15-1-2-15)16-4-13-3-14(5-16)10-31(9-13)18-11-32-12-18/h6-8,13-16,18,24H,1-5,9-12H2,(H2,27,28)
Standard InChI Key: FSXCTOOYHGALQD-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 38 0 0 0 0 0 0 0 0999 V2000
-3.0623 -8.2479 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0240 -6.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3035 -5.9653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6212 -6.6820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6596 -8.1815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3801 -8.9645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4108 -10.1641 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2675 -4.4650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9509 -3.7464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9100 -2.2700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1956 -1.4659 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.5123 -2.1845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5482 -3.6841 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.9795 -8.8958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.2586 -8.1106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.3140 -8.6817 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-8.2258 -6.9111 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-6.7936 -1.4033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1400 -1.1100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4363 -0.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.2151 -1.4171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8200 0.3600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4900 1.0900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9700 0.4500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2200 0.5600 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5500 -0.9300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3000 -0.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1000 -0.3800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2600 2.5200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3500 1.3800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7801 1.6166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4999 3.0902 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0263 2.8101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
3 8 1 0
5 14 1 0
14 15 1 0
15 16 1 0
15 17 1 0
12 18 1 0
19 10 1 0
20 18 1 0
21 20 1 0
18 21 1 0
19 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 19 1 0
27 29 1 0
23 29 1 0
25 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.53Molecular Weight (Monoisotopic): 457.2289AlogP: 3.81#Rotatable Bonds: 6Polar Surface Area: 86.39Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.90CX LogP: 3.64CX LogD: 3.02Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.71Np Likeness Score: -0.74
References 1. (2014) Biheteroaryl compounds and uses thereof,