5-[2-cyclopropyl-6-[3-(oxetan-3-yl)-3-azabicyclo[3.3.1]nonan-7-yl]pyrimidin-4-yl]-3-(difluoromethoxy)pyridin-2-amine

ID: ALA3733108

PubChem CID: 117688861

Max Phase: Preclinical

Molecular Formula: C24H29F2N5O2

Molecular Weight: 457.53

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1ncc(-c2cc(C3CC4CC(C3)CN(C3COC3)C4)nc(C3CC3)n2)cc1OC(F)F

Standard InChI:  InChI=1S/C24H29F2N5O2/c25-24(26)33-21-6-17(8-28-22(21)27)20-7-19(29-23(30-20)15-1-2-15)16-4-13-3-14(5-16)10-31(9-13)18-11-32-12-18/h6-8,13-16,18,24H,1-5,9-12H2,(H2,27,28)

Standard InChI Key:  FSXCTOOYHGALQD-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 38  0  0  0  0  0  0  0  0999 V2000
   -3.0623   -8.2479    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0240   -6.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3035   -5.9653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6212   -6.6820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6596   -8.1815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3801   -8.9645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4108  -10.1641    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2675   -4.4650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9509   -3.7464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9100   -2.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1956   -1.4659    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5123   -2.1845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5482   -3.6841    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9795   -8.8958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2586   -8.1106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.3140   -8.6817    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2258   -6.9111    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7936   -1.4033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1400   -1.1100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4363   -0.1352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2151   -1.4171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8200    0.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4900    1.0900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9700    0.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2200    0.5600    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5500   -0.9300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3000   -0.3100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1000   -0.3800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2600    2.5200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3500    1.3800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7801    1.6166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4999    3.0902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0263    2.8101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  3  8  1  0
  5 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  1  0
 12 18  1  0
 19 10  1  0
 20 18  1  0
 21 20  1  0
 18 21  1  0
 19 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 19  1  0
 27 29  1  0
 23 29  1  0
 25 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 30  1  0
M  END

Associated Targets(Human)

MAP3K12 Tchem Mitogen-activated protein kinase kinase kinase 12 (1076 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 457.53Molecular Weight (Monoisotopic): 457.2289AlogP: 3.81#Rotatable Bonds: 6
Polar Surface Area: 86.39Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.90CX LogP: 3.64CX LogD: 3.02
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.71Np Likeness Score: -0.74

References

1.  (2014)  Biheteroaryl compounds and uses thereof, 

Source