(Z)-N-(4-(methylthio)phenyl)-N'-(2-oxo-3-(thiophen-2-ylmethylene)indolin-5-yl)urea

ID: ALA3734883

PubChem CID: 127037282

Max Phase: Preclinical

Molecular Formula: C21H17N3O2S2

Molecular Weight: 407.52

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CSc1ccc(NC(=O)Nc2ccc3c(c2)/C(=C/c2cccs2)C(=O)N3)cc1

Standard InChI:  InChI=1S/C21H17N3O2S2/c1-27-15-7-4-13(5-8-15)22-21(26)23-14-6-9-19-17(11-14)18(20(25)24-19)12-16-3-2-10-28-16/h2-12H,1H3,(H,24,25)(H2,22,23,26)/b18-12-

Standard InChI Key:  OPQHOYIUVDTEGF-PDGQHHTCSA-N

Molfile:  

     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    3.7889    0.0269    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1855   -2.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6552   -2.9294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2542   -4.2907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7448   -4.1226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0456   -2.6531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7409   -1.9129    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6187   -1.4919    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6267   -2.9927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9300   -3.7369    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9380   -5.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2396   -5.9835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2445   -7.4835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9480   -8.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9499   -9.7387    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9118  -10.3406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6465   -7.4922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6415   -5.9922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5905   -3.5979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  4  9  1  0
  9 10  1  0
  2 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 12 16  1  0
  7 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
 23 26  1  0
 26 27  2  0
 20 27  1  0
 18 28  2  0
M  END

Alternative Forms

  1. Parent:

    ALA3734883

    ---

Associated Targets(Human)

ASPC1 (1310 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 407.52Molecular Weight (Monoisotopic): 407.0762AlogP: 5.61#Rotatable Bonds: 4
Polar Surface Area: 70.23Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.14CX Basic pKa: CX LogP: 4.95CX LogD: 4.95
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.39Np Likeness Score: -1.78

References

1. Sestito S, Nesi G, Daniele S, Martelli A, Digiacomo M, Borghini A, Pietra D, Calderone V, Lapucci A, Falasca M, Parrella P, Notarangelo A, Breschi MC, Macchia M, Martini C, Rapposelli S..  (2015)  Design and synthesis of 2-oxindole based multi-targeted inhibitors of PDK1/Akt signaling pathway for the treatment of glioblastoma multiforme.,  105  [PMID:26498573] [10.1016/j.ejmech.2015.10.020]

Source