The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-N-(4-(methylthio)phenyl)-N'-(2-oxo-3-(thiophen-2-ylmethylene)indolin-5-yl)urea ID: ALA3734883
PubChem CID: 127037282
Max Phase: Preclinical
Molecular Formula: C21H17N3O2S2
Molecular Weight: 407.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CSc1ccc(NC(=O)Nc2ccc3c(c2)/C(=C/c2cccs2)C(=O)N3)cc1
Standard InChI: InChI=1S/C21H17N3O2S2/c1-27-15-7-4-13(5-8-15)22-21(26)23-14-6-9-19-17(11-14)18(20(25)24-19)12-16-3-2-10-28-16/h2-12H,1H3,(H,24,25)(H2,22,23,26)/b18-12-
Standard InChI Key: OPQHOYIUVDTEGF-PDGQHHTCSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
3.7889 0.0269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1855 -2.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6552 -2.9294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2542 -4.2907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7448 -4.1226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0456 -2.6531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7409 -1.9129 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.6187 -1.4919 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6267 -2.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9300 -3.7369 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9380 -5.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2396 -5.9835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2445 -7.4835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9480 -8.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9499 -9.7387 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.9118 -10.3406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6465 -7.4922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6415 -5.9922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5905 -3.5979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
4 9 1 0
9 10 1 0
2 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
12 16 1 0
7 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 1 0
23 26 1 0
26 27 2 0
20 27 1 0
18 28 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 407.52Molecular Weight (Monoisotopic): 407.0762AlogP: 5.61#Rotatable Bonds: 4Polar Surface Area: 70.23Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.14CX Basic pKa: ┄CX LogP: 4.95CX LogD: 4.95Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.39Np Likeness Score: -1.78
References 1. Sestito S, Nesi G, Daniele S, Martelli A, Digiacomo M, Borghini A, Pietra D, Calderone V, Lapucci A, Falasca M, Parrella P, Notarangelo A, Breschi MC, Macchia M, Martini C, Rapposelli S.. (2015) Design and synthesis of 2-oxindole based multi-targeted inhibitors of PDK1/Akt signaling pathway for the treatment of glioblastoma multiforme., 105 [PMID:26498573 ] [10.1016/j.ejmech.2015.10.020 ]