The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2,4-Difluorophenyl)-1-(4-(5-(4-ethylphenyl)-1,3,4-oxadiazol-2-yl)piperidin-1-yl)-3-(1H-1,2,4-triazol-1-yl)propan-2-ol ID: ALA3734898
PubChem CID: 127034783
Max Phase: Preclinical
Molecular Formula: C26H28F2N6O2
Molecular Weight: 494.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCc1ccc(-c2nnc(C3CCN(CC(O)(Cn4cncn4)c4ccc(F)cc4F)CC3)o2)cc1
Standard InChI: InChI=1S/C26H28F2N6O2/c1-2-18-3-5-19(6-4-18)24-31-32-25(36-24)20-9-11-33(12-10-20)14-26(35,15-34-17-29-16-30-34)22-8-7-21(27)13-23(22)28/h3-8,13,16-17,20,35H,2,9-12,14-15H2,1H3
Standard InChI Key: ZXBYJAIIQZODRQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
1.2948 -3.7533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2926 -5.2541 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0797 -6.1147 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5441 -7.5410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0441 -7.5401 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5067 -6.1132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7390 2.9810 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2067 3.2905 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9546 1.9903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9492 0.8772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4469 1.8311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4153 2.9701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8906 2.6991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.3937 1.2860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.4213 0.1438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.9460 0.4147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6337 -3.6051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8958 -2.2552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1939 -3.0068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4938 -2.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4957 -0.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1976 -0.0068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8977 -0.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5357 -0.1598 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.1923 -4.2068 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-10.8692 1.0118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.2700 -0.1192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
1 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 5 1 0
4 10 1 0
4 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
12 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 15 1 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
2 26 1 0
2 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 1 0
28 34 1 0
23 35 1 0
35 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.55Molecular Weight (Monoisotopic): 494.2242AlogP: 3.94#Rotatable Bonds: 8Polar Surface Area: 93.10Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.85CX Basic pKa: 7.89CX LogP: 3.39CX LogD: 2.79Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.40Np Likeness Score: -1.33
References 1. He X, Jiang Y, Zhang Y, Wu S, Dong G, Liu N, Liu Y, Yao J, Miao Z, Wang Y, Zhang W, Sheng C. (2015) Discovery of highly potent triazoleantifungal agents with piperidine-oxadiazole side chains, 6 (4): [10.1039/C4MD00505H ]