The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3E)-N-(4-(methylsulfonyl)phenyl)-N'-(2-oxo-3-((1-methyl-1H-imidazol-2-yl)methylene)indolin-5-yl)urea ID: ALA3735019
PubChem CID: 127037285
Max Phase: Preclinical
Molecular Formula: C21H19N5O4S
Molecular Weight: 437.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cn1ccnc1/C=C1/C(=O)Nc2ccc(NC(=O)Nc3ccc(S(C)(=O)=O)cc3)cc21
Standard InChI: InChI=1S/C21H19N5O4S/c1-26-10-9-22-19(26)12-17-16-11-14(5-8-18(16)25-20(17)27)24-21(28)23-13-3-6-15(7-4-13)31(2,29)30/h3-12H,1-2H3,(H,25,27)(H2,23,24,28)/b17-12+
Standard InChI Key: ATIJRGHGXSCRHK-SFQUDFHCSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
3.7889 0.0269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1855 -2.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1889 -3.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2891 -3.5814 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8927 -4.9546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2267 -5.9530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5222 -5.1969 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6236 -5.6733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6187 -1.4919 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6267 -2.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9300 -3.7369 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9380 -5.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2396 -5.9835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2445 -7.4835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9480 -8.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9530 -9.7386 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-5.9938 -10.3358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9156 -10.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9564 -10.9386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6465 -7.4922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6415 -5.9922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5905 -3.5979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
4 9 1 0
9 10 1 0
2 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
12 16 1 0
16 17 1 0
7 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
25 27 1 0
25 28 2 0
24 29 1 0
29 30 2 0
21 30 1 0
19 31 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 437.48Molecular Weight (Monoisotopic): 437.1158AlogP: 2.96#Rotatable Bonds: 4Polar Surface Area: 122.19Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.92CX Basic pKa: 5.96CX LogP: 1.58CX LogD: 1.57Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.54Np Likeness Score: -1.48
References 1. Sestito S, Nesi G, Daniele S, Martelli A, Digiacomo M, Borghini A, Pietra D, Calderone V, Lapucci A, Falasca M, Parrella P, Notarangelo A, Breschi MC, Macchia M, Martini C, Rapposelli S.. (2015) Design and synthesis of 2-oxindole based multi-targeted inhibitors of PDK1/Akt signaling pathway for the treatment of glioblastoma multiforme., 105 [PMID:26498573 ] [10.1016/j.ejmech.2015.10.020 ]