The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-[4-(2-Adamantyl)-1,3-thiazol-2-yl]-2-(2,5-dimethoxyphenyl)-1,3-thiazolidin-4-one ID: ALA3735075
PubChem CID: 127035260
Max Phase: Preclinical
Molecular Formula: C24H28N2O3S2
Molecular Weight: 456.63
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(OC)c(C2SCC(=O)N2c2nc(C34CC5CC(CC(C5)C3)C4)cs2)c1
Standard InChI: InChI=1S/C24H28N2O3S2/c1-28-17-3-4-19(29-2)18(8-17)22-26(21(27)13-30-22)23-25-20(12-31-23)24-9-14-5-15(10-24)7-16(6-14)11-24/h3-4,8,12,14-16,22H,5-7,9-11,13H2,1-2H3
Standard InChI Key: LMMLDMOJNDEABH-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 36 0 0 0 0 0 0 0 0999 V2000
-4.0702 1.0031 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.8535 1.8804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6682 0.9900 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1118 -0.4305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6118 -0.4251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4027 -1.3986 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8388 3.3811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5991 4.2162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7038 5.7126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0520 6.3701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2955 5.5312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1908 4.0349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3710 2.7193 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.2078 1.3354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9296 0.3574 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1909 1.1452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8659 2.5965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5602 0.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7345 1.5436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7345 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8300 2.8133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5893 -0.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5602 2.2656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1246 2.2656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1246 0.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2034 -0.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0291 0.0249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2496 3.5595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7451 4.2307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6459 6.1863 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.6397 5.5138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
1 5 1 0
4 6 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
7 12 2 0
2 7 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
13 17 1 0
16 18 1 0
3 14 1 0
19 20 1 0
19 21 1 0
20 22 1 0
21 23 1 0
22 18 1 0
23 18 1 0
24 25 1 0
21 24 1 0
20 26 1 0
18 27 1 0
27 25 1 0
25 26 1 0
28 29 1 0
8 28 1 0
11 30 1 0
30 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.63Molecular Weight (Monoisotopic): 456.1541AlogP: 5.41#Rotatable Bonds: 5Polar Surface Area: 51.66Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.94CX LogD: 4.94Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.60Np Likeness Score: -0.72
References 1. Pitta E, Tsolaki E, Geronikaki A, Petrovic J, Glamoclija J, Sokovic M, Crespan E, Maga G, Bhunia SS, Saxena AK. (2015) 4-Thiazolidinone derivatives as potent antimicrobial agents: microwave-assisted synthesis, biological evaluation and docking studies, 6 (2): [10.1039/C4MD00399C ]