The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(benzo[d][1,3]dioxol-4-yl)-3-(pyridin-4-yl)-6-(3,4,5-trimethylpiperazin-1-yl)imidazo[1,2-b]pyridazine ID: ALA3735184
PubChem CID: 127035118
Max Phase: Preclinical
Molecular Formula: C25H26N6O2
Molecular Weight: 442.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC1CN(c2ccc3nc(-c4cccc5c4OCO5)c(-c4ccncc4)n3n2)CC(C)N1C
Standard InChI: InChI=1S/C25H26N6O2/c1-16-13-30(14-17(2)29(16)3)22-8-7-21-27-23(19-5-4-6-20-25(19)33-15-32-20)24(31(21)28-22)18-9-11-26-12-10-18/h4-12,16-17H,13-15H2,1-3H3
Standard InChI Key: YDPWORWQAOLKQD-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 38 0 0 0 0 0 0 0 0999 V2000
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1852 -2.6281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6168 -1.4950 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6203 -2.9951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9210 -3.7422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2184 -2.9893 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.2150 -1.4893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9143 -0.7422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2590 -3.5870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6221 -3.0405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9838 -4.4963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9039 -5.5373 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4624 -5.1227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1007 -3.6669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0896 0.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7638 -1.3325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2557 -1.4281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1039 -0.1670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9305 1.2694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4225 1.1738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9683 2.5638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8052 3.5152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5666 2.7177 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9237 -4.9422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2529 -0.8870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 2 0
2 3 2 0
3 6 1 0
5 4 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 2 0
7 10 1 0
2 11 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
14 17 1 0
10 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 10 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 28 1 0
27 23 1 0
8 23 1 0
27 28 2 0
28 29 1 0
29 30 1 0
30 31 1 0
31 27 1 0
13 32 1 0
15 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.52Molecular Weight (Monoisotopic): 442.2117AlogP: 3.72#Rotatable Bonds: 3Polar Surface Area: 68.02Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.86CX LogP: 4.04CX LogD: 3.46Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.48Np Likeness Score: -0.94
References 1. Moine E, Dimier-Poisson I, Enguehard-Gueiffier C, Logé C, Pénichon M, Moiré N, Delehouzé C, Foll-Josselin B, Ruchaud S, Bach S, Gueiffier A, Debierre-Grockiego F, Denevault-Sabourin C.. (2015) Development of new highly potent imidazo[1,2-b]pyridazines targeting Toxoplasma gondii calcium-dependent protein kinase 1., 105 [PMID:26479029 ] [10.1016/j.ejmech.2015.10.004 ]