The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(benzo[d][1,3]dioxol-4-yl)-6-(4-methylpiperazin-1-yl)-3-(pyridin-4-yl)imidazo[1,2-a]pyridine ID: ALA3735260
PubChem CID: 127035119
Max Phase: Preclinical
Molecular Formula: C24H23N5O2
Molecular Weight: 413.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN(c2ccc3nc(-c4cccc5c4OCO5)c(-c4ccncc4)n3c2)CC1
Standard InChI: InChI=1S/C24H23N5O2/c1-27-11-13-28(14-12-27)18-5-6-21-26-22(19-3-2-4-20-24(19)31-16-30-20)23(29(21)15-18)17-7-9-25-10-8-17/h2-10,15H,11-14,16H2,1H3
Standard InChI Key: WFAGOLWNQFGARG-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 36 0 0 0 0 0 0 0 0999 V2000
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1852 -2.6281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6168 -1.4950 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6203 -2.9951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9210 -3.7422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2184 -2.9893 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.2150 -1.4893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9143 -0.7422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2590 -3.5870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6221 -3.0405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9838 -4.4963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9039 -5.5373 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4624 -5.1227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1007 -3.6669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0896 0.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7638 -1.3325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2557 -1.4281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1039 -0.1670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9305 1.2694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4225 1.1738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9683 2.5638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8052 3.5152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5666 2.7177 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 2 0
2 3 2 0
3 6 1 0
5 4 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 2 0
7 10 1 0
2 11 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
14 17 1 0
10 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 10 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 28 1 0
27 23 1 0
8 23 1 0
27 28 2 0
28 29 1 0
29 30 1 0
30 31 1 0
31 27 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 413.48Molecular Weight (Monoisotopic): 413.1852AlogP: 3.54#Rotatable Bonds: 3Polar Surface Area: 55.13Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.64CX LogP: 2.72CX LogD: 2.28Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.51Np Likeness Score: -1.02
References 1. Moine E, Dimier-Poisson I, Enguehard-Gueiffier C, Logé C, Pénichon M, Moiré N, Delehouzé C, Foll-Josselin B, Ruchaud S, Bach S, Gueiffier A, Debierre-Grockiego F, Denevault-Sabourin C.. (2015) Development of new highly potent imidazo[1,2-b]pyridazines targeting Toxoplasma gondii calcium-dependent protein kinase 1., 105 [PMID:26479029 ] [10.1016/j.ejmech.2015.10.004 ]