N-(2-(benzo[d][1,3]dioxol-5-yl)ethyl)-N-(3,4-dimethoxyphenethyl)-3-(3,4,5-trimethoxyphenyl)propan-1-amine

ID: ALA3735261

PubChem CID: 127034715

Max Phase: Preclinical

Molecular Formula: C31H39NO7

Molecular Weight: 537.65

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(CCN(CCCc2cc(OC)c(OC)c(OC)c2)CCc2ccc3c(c2)OCO3)cc1OC

Standard InChI:  InChI=1S/C31H39NO7/c1-33-25-10-8-22(17-27(25)34-2)12-15-32(16-13-23-9-11-26-28(18-23)39-21-38-26)14-6-7-24-19-29(35-3)31(37-5)30(20-24)36-4/h8-11,17-20H,6-7,12-16,21H2,1-5H3

Standard InChI Key:  ZJLOUQPMUBFJJT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
  -11.3988   -1.5689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.3912   -3.0689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.0884   -3.8123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7932   -3.0557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8007   -1.5557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1036   -0.8123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.7008   -0.8224    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -12.7052    0.3776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.6856   -3.8285    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5063   -0.7961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5160    0.7047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2216    1.4644    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2313    2.9652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9153    0.7255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6217    1.4865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -12.6778   -5.0285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9369    3.7248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9466    5.2256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6522    5.9852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6598    7.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3645    8.2418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0617    7.4984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0541    5.9984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3493    5.2418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3752    9.7426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4183   10.3358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2358    8.2527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2772    7.6565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2479    5.2519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2523    4.0519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  1  7  1  0
  2  9  1  0
  5 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 21  1  0
 20 18  1  0
 18 19  2  0
 19 16  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 20  1  0
  9 25  1  0
 13 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 34 35  1  0
 30 34  1  0
 36 37  1  0
 31 36  1  0
 38 39  1  0
 32 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3735261

    ---

Associated Targets(Human)

HTR2C Tclin Serotonin 2c (5-HT2c) receptor (11471 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HTR2B Tclin Serotonin 2b (5-HT2b) receptor (10323 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HTR2A Tclin Serotonin 2a (5-HT2a) receptor (14758 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 537.65Molecular Weight (Monoisotopic): 537.2727AlogP: 5.18#Rotatable Bonds: 15
Polar Surface Area: 67.85Molecular Species: BASEHBA: 8HBD:
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 10.19CX LogP: 5.51CX LogD: 2.80
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.26Np Likeness Score: -0.12

References

1. Ponnala S, Kapadia N, Harding WW.  (2015)  Identification of tris-(phenylalkyl)amines as new selective h5-HT2Breceptor antagonists,  (4): [10.1039/C4MD00418C]

Source