The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(benzo[d][1,3]dioxol-5-yl)ethyl)-N-(3,4-dimethoxyphenethyl)-3-(3,4,5-trimethoxyphenyl)propan-1-amine ID: ALA3735261
PubChem CID: 127034715
Max Phase: Preclinical
Molecular Formula: C31H39NO7
Molecular Weight: 537.65
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CCN(CCCc2cc(OC)c(OC)c(OC)c2)CCc2ccc3c(c2)OCO3)cc1OC
Standard InChI: InChI=1S/C31H39NO7/c1-33-25-10-8-22(17-27(25)34-2)12-15-32(16-13-23-9-11-26-28(18-23)39-21-38-26)14-6-7-24-19-29(35-3)31(37-5)30(20-24)36-4/h8-11,17-20H,6-7,12-16,21H2,1-5H3
Standard InChI Key: ZJLOUQPMUBFJJT-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
-11.3988 -1.5689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.3912 -3.0689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.0884 -3.8123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.7932 -3.0557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8007 -1.5557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1036 -0.8123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.7008 -0.8224 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-12.7052 0.3776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.6856 -3.8285 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.5063 -0.7961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5160 0.7047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2216 1.4644 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.2313 2.9652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9153 0.7255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6217 1.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-12.6778 -5.0285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9369 3.7248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9466 5.2256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6522 5.9852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6598 7.4852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3645 8.2418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0617 7.4984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0541 5.9984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3493 5.2418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3752 9.7426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4183 10.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2358 8.2527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2772 7.6565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2479 5.2519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2523 4.0519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
1 7 1 0
2 9 1 0
5 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 21 1 0
20 18 1 0
18 19 2 0
19 16 1 0
20 21 2 0
21 22 1 0
22 23 1 0
23 24 1 0
24 20 1 0
9 25 1 0
13 26 1 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
34 35 1 0
30 34 1 0
36 37 1 0
31 36 1 0
38 39 1 0
32 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 537.65Molecular Weight (Monoisotopic): 537.2727AlogP: 5.18#Rotatable Bonds: 15Polar Surface Area: 67.85Molecular Species: BASEHBA: 8HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 10.19CX LogP: 5.51CX LogD: 2.80Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.26Np Likeness Score: -0.12
References 1. Ponnala S, Kapadia N, Harding WW. (2015) Identification of tris-(phenylalkyl)amines as new selective h5-HT2Breceptor antagonists, 6 (4): [10.1039/C4MD00418C ]