(1S,2S,3S,6R)-6-(octylamino)cyclohex-4-ene-1,2,3-triol hydrochloride

ID: ALA3735383

PubChem CID: 127037636

Max Phase: Preclinical

Molecular Formula: C14H28ClNO3

Molecular Weight: 257.37

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCN[C@@H]1C=C[C@H](O)[C@H](O)[C@H]1O.Cl

Standard InChI:  InChI=1S/C14H27NO3.ClH/c1-2-3-4-5-6-7-10-15-11-8-9-12(16)14(18)13(11)17;/h8-9,11-18H,2-7,10H2,1H3;1H/t11-,12+,13+,14+;/m1./s1

Standard InChI Key:  MJEHHCPQZDMBHY-KIBSRAOASA-N

Molfile:  

     RDKit          2D

 19 18  0  0  0  0  0  0  0  0999 V2000
    7.7187    4.4988    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383   -1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0031    3.0008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383    1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3039    3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3070    5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6078    5.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6109    7.4996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9117    8.2482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9148    9.7490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2156   10.4976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2180   11.6976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  6  1  0
  4  3  1  0
  5  2  2  0
  6  2  1  0
  7  5  1  0
  3  8  1  6
  7  9  1  6
  4 10  1  1
  6 11  1  6
  7  4  1  0
  9 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
M  END

Associated Targets(Human)

GLB1 Tchem Beta-galactosidase (339 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GBA1 Tclin Beta-glucocerebrosidase (14647 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

GLB1 Beta-galactosidase (500 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 257.37Molecular Weight (Monoisotopic): 257.1991AlogP: 0.96#Rotatable Bonds: 8
Polar Surface Area: 72.72Molecular Species: BASEHBA: 4HBD: 4
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 12.89CX Basic pKa: 8.73CX LogP: 1.43CX LogD: 0.08
Aromatic Rings: Heavy Atoms: 18QED Weighted: 0.39Np Likeness Score: 1.32

References

1. Kuno S, Higaki K, Takahashi A, Nanba E, Ogawa S.  (2015)  Potent chemical chaperone compounds for GM1-gangliosidosis: N-substituted (+)-conduramine F-4 derivatives,  (2): [10.1039/C4MD00270A]

Source