(R)-N-(2-phenylpropyl)-1-[2'-(1H-tetrazol-5-yl)-1,1'-biphenyl-4-yl]methyl-4-methyl-2-(ethylthio)-1H-benzimidazole-6-carboxamide

ID: ALA3735558

PubChem CID: 127035557

Max Phase: Preclinical

Molecular Formula: C34H33N7OS

Molecular Weight: 587.75

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCSc1nc2c(C)cc(C(=O)NC[C@H](C)c3ccccc3)cc2n1Cc1ccc(-c2ccccc2-c2nnn[nH]2)cc1

Standard InChI:  InChI=1S/C34H33N7OS/c1-4-43-34-36-31-22(2)18-27(33(42)35-20-23(3)25-10-6-5-7-11-25)19-30(31)41(34)21-24-14-16-26(17-15-24)28-12-8-9-13-29(28)32-37-39-40-38-32/h5-19,23H,4,20-21H2,1-3H3,(H,35,42)(H,37,38,39,40)/t23-/m0/s1

Standard InChI Key:  PRCRZUBJQQJBJH-QHCPKHFHSA-N

Molfile:  

     RDKit          2D

 43 48  0  0  0  0  0  0  0  0999 V2000
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6187   -1.4919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6549   -0.8867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6267   -2.9927    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0872    0.0382    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.8208    1.3475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0207    1.3637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9991    2.7132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1855   -2.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5944   -3.5310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5991   -4.6533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1295   -4.3524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6552   -2.9294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6506   -1.8071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1201   -2.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0646   -3.8320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5412   -5.2544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0112   -5.5528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0047   -4.4290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5282   -3.0067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0582   -2.7082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8892   -7.8262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5983   -8.5900    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4729   -7.5983    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0683   -6.2216    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5473   -6.3788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9300   -3.7369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9380   -5.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9019   -5.8430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2413   -5.9820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2516   -7.4820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5557   -8.2232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8496   -7.4644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8394   -5.9645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5354   -5.2233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  1  5  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  4  9  2  0
  3  6  2  0
 10 11  2  0
 10 12  1  0
  8 10  1  0
 14 15  1  0
 13 14  1  0
  1 13  1  0
  6 16  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 18 23  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 24 29  2  0
 18 24  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 30 34  1  0
 25 34  1  0
 17 21  1  0
  5 17  1  0
 35 36  1  0
 36 37  1  6
 38 39  1  0
 39 40  2  0
 40 41  1  0
 41 42  2  0
 42 43  1  0
 38 43  2  0
 36 38  1  0
 12 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3735558

    ---

Associated Targets(Human)

AGTR1 Tclin Type-1 angiotensin II receptor (5176 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 587.75Molecular Weight (Monoisotopic): 587.2467AlogP: 6.89#Rotatable Bonds: 10
Polar Surface Area: 101.38Molecular Species: ACIDHBA: 7HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.26CX Basic pKa: 3.76CX LogP: 7.33CX LogD: 6.07
Aromatic Rings: 6Heavy Atoms: 43QED Weighted: 0.17Np Likeness Score: -1.60

References

1. Han XF, He X, Wang M, Xu D, Hao LP, Liang AH, Zhang J, Zhou ZM..  (2015)  Discovery of novel, potent and low-toxicity angiotensin II receptor type 1 (AT1) blockers: Design, synthesis and biological evaluation of 6-substituted aminocarbonyl benzimidazoles with a chiral center.,  103  [PMID:26397395] [10.1016/j.ejmech.2015.09.010]

Source