The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-N-(2-phenylpropyl)-1-[2'-(1H-tetrazol-5-yl)-1,1'-biphenyl-4-yl]methyl-4-methyl-2-(ethylthio)-1H-benzimidazole-6-carboxamide ID: ALA3735558
PubChem CID: 127035557
Max Phase: Preclinical
Molecular Formula: C34H33N7OS
Molecular Weight: 587.75
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCSc1nc2c(C)cc(C(=O)NC[C@H](C)c3ccccc3)cc2n1Cc1ccc(-c2ccccc2-c2nnn[nH]2)cc1
Standard InChI: InChI=1S/C34H33N7OS/c1-4-43-34-36-31-22(2)18-27(33(42)35-20-23(3)25-10-6-5-7-11-25)19-30(31)41(34)21-24-14-16-26(17-15-24)28-12-8-9-13-29(28)32-37-39-40-38-32/h5-19,23H,4,20-21H2,1-3H3,(H,35,42)(H,37,38,39,40)/t23-/m0/s1
Standard InChI Key: PRCRZUBJQQJBJH-QHCPKHFHSA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6187 -1.4919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6549 -0.8867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6267 -2.9927 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0872 0.0382 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.8208 1.3475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0207 1.3637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9991 2.7132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1855 -2.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5944 -3.5310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5991 -4.6533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1295 -4.3524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6552 -2.9294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6506 -1.8071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1201 -2.1080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0646 -3.8320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5412 -5.2544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0112 -5.5528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0047 -4.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5282 -3.0067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0582 -2.7082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8892 -7.8262 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5983 -8.5900 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4729 -7.5983 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0683 -6.2216 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5473 -6.3788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9300 -3.7369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9380 -5.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9019 -5.8430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2413 -5.9820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2516 -7.4820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5557 -8.2232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8496 -7.4644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8394 -5.9645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5354 -5.2233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 1 0
1 5 1 0
6 7 1 0
7 8 2 0
8 9 1 0
4 9 2 0
3 6 2 0
10 11 2 0
10 12 1 0
8 10 1 0
14 15 1 0
13 14 1 0
1 13 1 0
6 16 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
18 23 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
24 29 2 0
18 24 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
30 34 1 0
25 34 1 0
17 21 1 0
5 17 1 0
35 36 1 0
36 37 1 6
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 43 1 0
38 43 2 0
36 38 1 0
12 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 587.75Molecular Weight (Monoisotopic): 587.2467AlogP: 6.89#Rotatable Bonds: 10Polar Surface Area: 101.38Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.26CX Basic pKa: 3.76CX LogP: 7.33CX LogD: 6.07Aromatic Rings: 6Heavy Atoms: 43QED Weighted: 0.17Np Likeness Score: -1.60
References 1. Han XF, He X, Wang M, Xu D, Hao LP, Liang AH, Zhang J, Zhou ZM.. (2015) Discovery of novel, potent and low-toxicity angiotensin II receptor type 1 (AT1) blockers: Design, synthesis and biological evaluation of 6-substituted aminocarbonyl benzimidazoles with a chiral center., 103 [PMID:26397395 ] [10.1016/j.ejmech.2015.09.010 ]