The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2,4-Difluorophenyl)-1-(4-(5-(furan-2-yl)-1,3,4-oxadiazol-2-yl)piperidin-1-yl)-3-(1H-1,2,4-triazol-1-yl)propan-2-ol ID: ALA3735849
PubChem CID: 127034970
Max Phase: Preclinical
Molecular Formula: C22H22F2N6O3
Molecular Weight: 456.45
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: OC(CN1CCC(c2nnc(-c3ccco3)o2)CC1)(Cn1cncn1)c1ccc(F)cc1F
Standard InChI: InChI=1S/C22H22F2N6O3/c23-16-3-4-17(18(24)10-16)22(31,12-30-14-25-13-26-30)11-29-7-5-15(6-8-29)20-27-28-21(33-20)19-2-1-9-32-19/h1-4,9-10,13-15,31H,5-8,11-12H2
Standard InChI Key: XDQBVQOQXXCZLQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
1.2948 -3.7533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2926 -5.2541 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0797 -6.1147 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5441 -7.5410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0441 -7.5401 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5067 -6.1132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7390 2.9810 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2067 3.2905 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9546 1.9903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9492 0.8772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6337 -3.6051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8958 -2.2552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1939 -3.0068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4938 -2.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4957 -0.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1976 -0.0068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8977 -0.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5357 -0.1598 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.1923 -4.2068 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-6.4469 1.8311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5110 2.8633 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.8282 2.1458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.5529 0.6713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.0654 0.4775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
1 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 5 1 0
4 10 1 0
4 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
12 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 15 1 0
2 20 1 0
2 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
22 28 1 0
29 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 29 2 0
18 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.45Molecular Weight (Monoisotopic): 456.1721AlogP: 2.97#Rotatable Bonds: 7Polar Surface Area: 106.24Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.85CX Basic pKa: 7.86CX LogP: 1.50CX LogD: 0.90Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.45Np Likeness Score: -1.57
References 1. He X, Jiang Y, Zhang Y, Wu S, Dong G, Liu N, Liu Y, Yao J, Miao Z, Wang Y, Zhang W, Sheng C. (2015) Discovery of highly potent triazoleantifungal agents with piperidine-oxadiazole side chains, 6 (4): [10.1039/C4MD00505H ]