(rac)-5-(1-tert-butyl-4,5,6,7-tetrahydro-1H-benzo[d][1,2,3]triazol-5-yl)-3-cyclohexyl-1,2,4-oxadiazole

ID: ALA3736066

PubChem CID: 127034897

Max Phase: Preclinical

Molecular Formula: C18H27N5O

Molecular Weight: 329.45

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(C)n1nnc2c1CCC(c1nc(C3CCCCC3)no1)C2

Standard InChI:  InChI=1S/C18H27N5O/c1-18(2,3)23-15-10-9-13(11-14(15)20-22-23)17-19-16(21-24-17)12-7-5-4-6-8-12/h12-13H,4-11H2,1-3H3

Standard InChI Key:  WWNTZZFTQLZTTN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 27  0  0  0  0  0  0  0  0999 V2000
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6168   -1.4950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7580   -2.9756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2259   -3.2843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9730   -1.9836    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9669   -0.8711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1783    2.6281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3521    2.8771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3759    3.5204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5497    3.7691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8393   -4.6540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0560   -5.9274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7704   -7.2464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2699   -7.2872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0549   -6.0091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3406   -4.6901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6  4  1  0
  5  1  1  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  1  0
  3 10  1  0
  9 15  1  0
 15 16  1  0
 15 17  1  0
 15 18  1  0
 19 20  1  0
 19 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 12 19  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3736066

    ---

Associated Targets(Human)

GRM5 Tchem Metabotropic glutamate receptor 5 (5733 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Grm5 Metabotropic glutamate receptor 5 (4372 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 329.45Molecular Weight (Monoisotopic): 329.2216AlogP: 3.74#Rotatable Bonds: 2
Polar Surface Area: 69.63Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.74CX LogP: 3.70CX LogD: 3.70
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.84Np Likeness Score: -1.51

References

1. Ellard JM, Madin A, Philps O, Hopkin M, Henderson S, Birch L, O'Connor D, Arai T, Takase K, Morgan L, Reynolds D, Talma S, Howley E, Powney B, Payne AH, Hall A, Gartlon JE, Dawson LA, Castro L, Atkinson PJ..  (2015)  Identification and optimisation of a series of tetrahydrobenzotriazoles as metabotropic glutamate receptor 5-selective positive allosteric modulators that improve performance in a preclinical model of cognition.,  25  (24): [PMID:26531152] [10.1016/j.bmcl.2015.10.050]

Source