(2R,3S,5R)-2-(2,5-difluorophenyl)-5-(2-(trifluoromethylsulfonyl)pyrrolo[3,4-c]pyrazol-5(2H,4H,6H)-yl)tetrahydro-2H-pyran-3-amine

ID: ALA3736188

PubChem CID: 127035239

Max Phase: Preclinical

Molecular Formula: C17H17F5N4O3S

Molecular Weight: 452.41

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N[C@H]1C[C@@H](N2Cc3cn(S(=O)(=O)C(F)(F)F)nc3C2)CO[C@@H]1c1cc(F)ccc1F

Standard InChI:  InChI=1S/C17H17F5N4O3S/c18-10-1-2-13(19)12(3-10)16-14(23)4-11(8-29-16)25-5-9-6-26(24-15(9)7-25)30(27,28)17(20,21)22/h1-3,6,11,14,16H,4-5,7-8,23H2/t11-,14+,16-/m1/s1

Standard InChI Key:  PPSPTBICLQCIEZ-DIOULYMOSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    6.4140    2.2411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1942    0.7573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7992    0.2058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6284    1.1358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8440    2.6219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2389    3.1734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4148    4.3604    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1968    0.6852    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9876    1.5922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7333   -0.7256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2217   -0.7054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2419    0.7054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7333    0.7457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1968   -0.7054    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9876   -1.5720    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8096    2.7929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9833    1.8588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3791    2.4081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6013    3.8916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4277    4.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0319    4.2764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3180    1.6608    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.0930    5.0238    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6167   -1.1834    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7433   -0.1919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8532   -2.3599    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7162   -1.9766    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8806   -0.5749    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5068    0.9846    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6438    0.6013    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  6
  4  8  1  6
  8  9  1  0
  9 12  1  0
 11 10  1  0
 10  8  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 11  2  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  1 16  1  1
 18 22  1  0
 21 23  1  0
 14 24  1  0
 24 25  1  0
 24 26  2  0
 24 27  2  0
 25 28  1  0
 25 29  1  0
 25 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3736188

    ---

Associated Targets(Human)

DPP7 Tchem Dipeptidyl peptidase II (2000 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
DPP8 Tchem Dipeptidyl peptidase VIII (2139 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
DPP4 Tclin Dipeptidyl peptidase IV (7109 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

FAP Prolyl endopeptidase FAP (28 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 452.41Molecular Weight (Monoisotopic): 452.0942AlogP: 2.03#Rotatable Bonds: 3
Polar Surface Area: 90.45Molecular Species: BASEHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.81CX LogP: 2.21CX LogD: 0.79
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.72Np Likeness Score: -0.50

References

1. Chen P, Feng D, Qian X, Apgar J, Wilkening R, Kuethe JT, Gao YD, Scapin G, Cox J, Doss G, Eiermann G, He H, Li X, Lyons KA, Metzger J, Petrov A, Wu JK, Xu S, Weber AE, Yan Y, Roy RS, Biftu T..  (2015)  Structure-activity-relationship of amide and sulfonamide analogs of omarigliptin.,  25  (24): [PMID:26546218] [10.1016/j.bmcl.2015.10.070]

Source