The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-4'-[[4-methyl-6-((2-phenylpropyl)carbamoyl)-2-(ethylthio)-1H-benzimidazol-1-yl]methyl]-biphenyl-2-carboxylic acid ID: ALA3736202
PubChem CID: 127035392
Max Phase: Preclinical
Molecular Formula: C34H33N3O3S
Molecular Weight: 563.72
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCSc1nc2c(C)cc(C(=O)NC[C@H](C)c3ccccc3)cc2n1Cc1ccc(-c2ccccc2C(=O)O)cc1
Standard InChI: InChI=1S/C34H33N3O3S/c1-4-41-34-36-31-22(2)18-27(32(38)35-20-23(3)25-10-6-5-7-11-25)19-30(31)37(34)21-24-14-16-26(17-15-24)28-12-8-9-13-29(28)33(39)40/h5-19,23H,4,20-21H2,1-3H3,(H,35,38)(H,39,40)/t23-/m0/s1
Standard InChI Key: FWZUAHSNDPMYKQ-QHCPKHFHSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
8.0646 -3.8320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5412 -5.2544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0112 -5.5528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0047 -4.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5282 -3.0067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0582 -2.7082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5944 -3.5310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5991 -4.6533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1295 -4.3524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6552 -2.9294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6506 -1.8071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1201 -2.1080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5495 -6.3809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9324 -7.5182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3731 -6.1442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1855 -2.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0872 0.0382 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.8208 1.3475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0207 1.3637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6187 -1.4919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6267 -2.9927 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.6549 -0.8867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9300 -3.7369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9380 -5.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9019 -5.8430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2413 -5.9820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2516 -7.4820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5557 -8.2232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8496 -7.4644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8394 -5.9645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5354 -5.2233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9991 2.7132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
7 12 2 0
1 7 1 0
13 14 2 0
13 15 1 0
2 13 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 1 0
17 21 1 0
22 23 1 0
23 24 2 0
24 25 1 0
20 25 2 0
19 22 2 0
27 28 1 0
26 27 1 0
17 26 1 0
29 30 1 0
29 31 2 0
32 33 1 0
33 34 1 6
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
35 40 2 0
33 35 1 0
30 32 1 0
24 29 1 0
22 41 1 0
16 21 1 0
10 16 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 563.72Molecular Weight (Monoisotopic): 563.2243AlogP: 7.40#Rotatable Bonds: 10Polar Surface Area: 84.22Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.43CX Basic pKa: 4.04CX LogP: 7.37CX LogD: 4.74Aromatic Rings: 5Heavy Atoms: 41QED Weighted: 0.17Np Likeness Score: -1.30
References 1. Han XF, He X, Wang M, Xu D, Hao LP, Liang AH, Zhang J, Zhou ZM.. (2015) Discovery of novel, potent and low-toxicity angiotensin II receptor type 1 (AT1) blockers: Design, synthesis and biological evaluation of 6-substituted aminocarbonyl benzimidazoles with a chiral center., 103 [PMID:26397395 ] [10.1016/j.ejmech.2015.09.010 ]