(3E)-N-(4-(methylthio)phenyl)-N'-(2-oxo-(3-(1-methyl-1H-imidazol-2-yl)methylene)-indolin-5-yl)urea

ID: ALA3736265

PubChem CID: 127037283

Max Phase: Preclinical

Molecular Formula: C21H19N5O2S

Molecular Weight: 405.48

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CSc1ccc(NC(=O)Nc2ccc3c(c2)/C(=C\c2nccn2C)C(=O)N3)cc1

Standard InChI:  InChI=1S/C21H19N5O2S/c1-26-10-9-22-19(26)12-17-16-11-14(5-8-18(16)25-20(17)27)24-21(28)23-13-3-6-15(29-2)7-4-13/h3-12H,1-2H3,(H,25,27)(H2,23,24,28)/b17-12+

Standard InChI Key:  HHVUJHPMRXIBKN-SFQUDFHCSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    3.7889    0.0269    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1855   -2.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1889   -3.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2891   -3.5814    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8927   -4.9546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2267   -5.9530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5222   -5.1969    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6236   -5.6733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6187   -1.4919    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6267   -2.9927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9300   -3.7369    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9380   -5.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2396   -5.9835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2445   -7.4835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9480   -8.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9499   -9.7387    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9118  -10.3406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6465   -7.4922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6415   -5.9922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5905   -3.5979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  4  9  1  0
  9 10  1  0
  2 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 12 16  1  0
 16 17  1  0
  7 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 24 27  1  0
 27 28  2  0
 21 28  1  0
 19 29  2  0
M  END

Alternative Forms

  1. Parent:

    ALA3736265

    ---

Associated Targets(Human)

ASPC1 (1310 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 405.48Molecular Weight (Monoisotopic): 405.1259AlogP: 4.28#Rotatable Bonds: 4
Polar Surface Area: 88.05Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 11.11CX Basic pKa: 5.96CX LogP: 3.37CX LogD: 3.36
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.45Np Likeness Score: -1.46

References

1. Sestito S, Nesi G, Daniele S, Martelli A, Digiacomo M, Borghini A, Pietra D, Calderone V, Lapucci A, Falasca M, Parrella P, Notarangelo A, Breschi MC, Macchia M, Martini C, Rapposelli S..  (2015)  Design and synthesis of 2-oxindole based multi-targeted inhibitors of PDK1/Akt signaling pathway for the treatment of glioblastoma multiforme.,  105  [PMID:26498573] [10.1016/j.ejmech.2015.10.020]

Source