(S)-5-guanidino-2-(5-methyl-2-((S)-3-methyl-1-(4-(trifluoromethyl)benzamido)butyl)oxazole-4-carboxamido)pentanoic acid

ID: ALA3736337

PubChem CID: 127035108

Max Phase: Preclinical

Molecular Formula: C24H31F3N6O5

Molecular Weight: 540.54

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1oc([C@H](CC(C)C)NC(=O)c2ccc(C(F)(F)F)cc2)nc1C(=O)N[C@@H](CCCNC(=N)N)C(=O)O

Standard InChI:  InChI=1S/C24H31F3N6O5/c1-12(2)11-17(32-19(34)14-6-8-15(9-7-14)24(25,26)27)21-33-18(13(3)38-21)20(35)31-16(22(36)37)5-4-10-30-23(28)29/h6-9,12,16-17H,4-5,10-11H2,1-3H3,(H,31,35)(H,32,34)(H,36,37)(H4,28,29,30)/t16-,17-/m0/s1

Standard InChI Key:  HZZPWXWAJRDGNZ-IRXDYDNUSA-N

Molfile:  

     RDKit          2D

 38 39  0  0  0  0  0  0  0  0999 V2000
    4.6332   -7.5468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5122   -8.7602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0051   -8.6063    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8856   -9.8217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3785   -9.6679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2589  -10.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7519  -10.7295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6323  -11.9449    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1252  -11.7911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6152  -10.6957    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.8292  -12.7629    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0222   -9.8556    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1017   -6.1218    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8912   -5.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6375   -0.9049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1959   -3.0115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6747   -6.1134    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1332   -7.5416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2756  -11.1930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4933   -3.7660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4245   -8.5100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5348   -3.1700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4891   -4.9660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5988    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5996    2.7004    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6378    0.9001    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6383    2.0999    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.9806  -12.1641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0822  -11.3185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4 22  1  1
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
  2 12  2  0
  1 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 15 19  1  1
 20 14  1  0
 21 20  1  0
  1 21  2  0
 19 23  1  0
 17 24  1  0
 21 25  1  0
 23 26  1  0
 23 27  1  0
 24 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 24  1  0
 33 34  1  0
 33 35  1  0
 33 36  1  0
 30 33  1  0
 22 37  2  0
 22 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3736337

    ---

Associated Targets(Human)

C5AR1 Tclin C5a anaphylatoxin chemotactic receptor (2677 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
C3AR1 Tchem C3a anaphylatoxin chemotactic receptor (750 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 540.54Molecular Weight (Monoisotopic): 540.2308AlogP: 2.97#Rotatable Bonds: 12
Polar Surface Area: 183.43Molecular Species: ZWITTERIONHBA: 6HBD: 6
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 7#RO5 Violations (Lipinski): 3
CX Acidic pKa: 3.98CX Basic pKa: 11.77CX LogP: 0.64CX LogD: 0.64
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.13Np Likeness Score: -0.60

References

1. Singh R, Reed AN, Chu P, Scully CC, Yau MK, Suen JY, Durek T, Reid RC, Fairlie DP..  (2015)  Potent complement C3a receptor agonists derived from oxazole amino acids: Structure-activity relationships.,  25  (23): [PMID:26522948] [10.1016/j.bmcl.2015.10.038]

Source