The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Istradefylline ID: ALA3736368
Cas Number: 155270-98-7
PubChem CID: 6445788
Max Phase: Preclinical
Molecular Formula: C19H22N4O4
Molecular Weight: 370.41
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCn1c(=O)c2[nH]c(/C=C/c3ccc(OC)c(OC)c3)nc2n(CC)c1=O
Standard InChI: InChI=1S/C19H22N4O4/c1-5-22-17-16(18(24)23(6-2)19(22)25)20-15(21-17)10-8-12-7-9-13(26-3)14(11-12)27-4/h7-11H,5-6H2,1-4H3,(H,20,21)/b10-8+
Standard InChI Key: IZFYJVITWLNDJA-CSKARUKUSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
-2.3155 0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0872 0.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8208 1.3475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3215 1.3677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0567 2.6752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5566 2.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3214 1.4020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5863 0.0945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0864 0.0773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8222 1.4161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4326 0.3829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2895 4.0021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6762 5.0336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9971 -3.0138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0337 -3.6184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6187 1.4919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6251 2.6919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9991 2.7132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3560 -1.3452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
8 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
15 18 1 0
18 19 1 0
14 20 1 0
20 21 1 0
3 22 1 0
22 23 1 0
1 24 1 0
24 25 1 0
4 26 2 0
2 27 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 370.41Molecular Weight (Monoisotopic): 370.1641AlogP: 2.11#Rotatable Bonds: 6Polar Surface Area: 91.14Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.30CX Basic pKa: ┄CX LogP: 2.19CX LogD: 1.90Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.72Np Likeness Score: -0.55
References 1. Robinson SJ, Petzer JP, Terre'Blanche G, Petzer A, van der Walt MM, Bergh JJ, Lourens AC.. (2015) 2-Aminopyrimidines as dual adenosine A1/A2A antagonists., 104 [PMID:26462195 ] [10.1016/j.ejmech.2015.09.035 ]