The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
diethyl 4,4'-(4,4'-oxybis(4,1-phenylene)bis(azanediyl))bis(4-oxobutanoate) ID: ALA3736467
PubChem CID: 4652210
Max Phase: Preclinical
Molecular Formula: C24H28N2O7
Molecular Weight: 456.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)CCC(=O)Nc1ccc(Oc2ccc(NC(=O)CCC(=O)OCC)cc2)cc1
Standard InChI: InChI=1S/C24H28N2O7/c1-3-31-23(29)15-13-21(27)25-17-5-9-19(10-6-17)33-20-11-7-18(8-12-20)26-22(28)14-16-24(30)32-4-2/h5-12H,3-4,13-16H2,1-2H3,(H,25,27)(H,26,28)
Standard InChI Key: IQXRIWGGSAJUPW-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 34 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5972 -1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8915 -3.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8863 -5.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5847 -6.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2883 -5.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2935 -3.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5972 1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5548 3.6021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8912 5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1894 6.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1872 7.5118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2296 5.4128 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4854 8.2649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4837 9.4649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5764 -7.5048 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2730 -8.2489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2647 -9.7497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2369 -7.6435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0387 -10.4937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0470 -11.9945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3504 -12.7386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9891 -12.5999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3586 -14.2394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4008 -14.8343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
2 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 1 0
11 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
30 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.50Molecular Weight (Monoisotopic): 456.1897AlogP: 4.04#Rotatable Bonds: 12Polar Surface Area: 120.03Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.60CX LogD: 2.60Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.46Np Likeness Score: -0.60
References 1. Wang X, Sun C, Fang L, Yin D. (2015) Discovery of novel sphingosine kinase 1 inhibitors via structure-based hierarchical virtual screening, 6 (3): [10.1039/C4MD00312H ]