The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 10-(2-((S)-2-methoxy-2-oxo-1-phenylethylamino)-2-oxoethylthio)octadecanoate ID: ALA3746346
PubChem CID: 127037938
Max Phase: Preclinical
Molecular Formula: C30H49NO5S
Molecular Weight: 535.79
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCC(CCCCCCCCC(=O)OC)SCC(=O)N[C@H](C(=O)OC)c1ccccc1
Standard InChI: InChI=1S/C30H49NO5S/c1-4-5-6-7-10-16-21-26(22-17-11-8-9-12-18-23-28(33)35-2)37-24-27(32)31-29(30(34)36-3)25-19-14-13-15-20-25/h13-15,19-20,26,29H,4-12,16-18,21-24H2,1-3H3,(H,31,32)/t26?,29-/m0/s1
Standard InChI Key: CZGCEDSBPRAIMX-BTMGADRYSA-N
Molfile:
RDKit 2D
37 37 0 0 0 0 0 0 0 0999 V2000
-4.9526 -7.6268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9152 -8.2301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6126 -7.4846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3153 -8.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0127 -7.4936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2847 -8.2482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5873 -7.5027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8847 -8.2572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1873 -7.5117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4855 -8.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4833 -9.7656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7815 -10.5187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7794 -12.0195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0776 -12.7726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0755 -14.2734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3737 -15.0265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3716 -16.5273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6698 -17.2804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6676 -18.7813 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7056 -19.3834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7100 -16.6822 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1894 -6.0109 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.8912 -5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9336 -3.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8999 -0.7576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9040 0.4424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1972 -1.5121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2387 -0.9161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
18 21 2 0
9 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
25 27 1 0
27 28 1 0
28 29 2 0
28 30 1 0
30 31 1 0
27 32 1 1
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 535.79Molecular Weight (Monoisotopic): 535.3331AlogP: 7.16#Rotatable Bonds: 22Polar Surface Area: 81.70Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.21CX Basic pKa: ┄CX LogP: 7.58CX LogD: 7.58Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.13Np Likeness Score: -0.33
References 1. Kaki SS, Arukali S, Korlipara PV, Prasad RB, Yedla P, Ganesh Kumar C.. (2016) Synthesis and biological evaluation of novel lipoamino acid derivatives., 26 (1): [PMID:26586599 ] [10.1016/j.bmcl.2015.10.086 ]