The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(1-Adamantyl)benzyl 5-[hydroxy(tetrahydrofuran-2-yl)amino]isoxazole-3-carboxylate ID: ALA3746445
PubChem CID: 127038655
Max Phase: Preclinical
Molecular Formula: C25H30N2O5
Molecular Weight: 438.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(OCc1ccc(C23CC4CC(CC(C4)C2)C3)cc1)c1cc(N(O)C2CCCO2)on1
Standard InChI: InChI=1S/C25H30N2O5/c28-24(21-11-23(32-26-21)27(29)22-2-1-7-30-22)31-15-16-3-5-20(6-4-16)25-12-17-8-18(13-25)10-19(9-17)14-25/h3-6,11,17-19,22,29H,1-2,7-10,12-15H2
Standard InChI Key: ZPBVBAGLRHZELG-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 37 0 0 0 0 0 0 0 0999 V2000
-3.7212 6.4443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0318 7.1473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7483 8.6203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2598 8.8059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6233 7.4476 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.7699 9.7163 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.9391 9.4462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.3317 11.1517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2388 12.3302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.3765 13.5576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9427 13.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9190 11.6169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5324 4.9553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4882 4.2297 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1490 4.3735 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7345 1.5436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7345 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8300 2.8133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5893 -0.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5602 2.2656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5602 0.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1246 2.2656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1246 0.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2034 -0.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0291 0.0249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1909 1.1452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9978 0.2361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3861 0.8149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5768 2.3027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6163 3.2118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0002 2.6331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9603 2.8846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 1 2 0
3 6 1 0
6 7 1 0
6 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 8 1 0
1 13 1 0
13 14 2 0
13 15 1 0
16 17 1 0
16 18 1 0
17 19 1 0
18 20 1 0
19 21 1 0
20 21 1 0
22 23 1 0
18 22 1 0
17 24 1 0
21 25 1 0
25 23 1 0
23 24 1 0
21 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
29 32 1 0
32 15 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 438.52Molecular Weight (Monoisotopic): 438.2155AlogP: 4.83#Rotatable Bonds: 6Polar Surface Area: 85.03Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.31CX Basic pKa: ┄CX LogP: 4.88CX LogD: 5.08Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.51Np Likeness Score: -0.51
References 1. Averina EB, Vasilenko DA, Gracheva YA, Grishin YK, Radchenko EV, Burmistrov VV, Butov GM, Neganova ME, Serkova TP, Redkozubova OM, Shevtsova EF, Milaeva ER, Kuznetsova TS, Zefirov NS.. (2016) Synthesis and biological evaluation of novel 5-hydroxylaminoisoxazole derivatives as lipoxygenase inhibitors and metabolism enhancing agents., 24 (4): [PMID:26753816 ] [10.1016/j.bmc.2015.12.040 ]