8-((2-(Dimethylamino)ethyl)methylamino)-9-ethyl-6,6-dimethyl-11-oxo-6,11-dihydro-5H-benzo[b]carbazole-3-carbonitrile

ID: ALA3746452

PubChem CID: 127038286

Max Phase: Preclinical

Molecular Formula: C26H30N4O

Molecular Weight: 414.55

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCc1cc2c(cc1N(C)CCN(C)C)C(C)(C)c1[nH]c3cc(C#N)ccc3c1C2=O

Standard InChI:  InChI=1S/C26H30N4O/c1-7-17-13-19-20(14-22(17)30(6)11-10-29(4)5)26(2,3)25-23(24(19)31)18-9-8-16(15-27)12-21(18)28-25/h8-9,12-14,28H,7,10-11H2,1-6H3

Standard InChI Key:  YHTBSIJWBFUQQQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    0.0000   -0.3300    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2600    0.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5200   -0.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8000    0.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8000    1.8600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5200    2.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2600    1.8600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2800    1.8600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5200    2.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7800    1.8600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7800    0.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5200   -0.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2800    0.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0500    2.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3600    1.8600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3600    0.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0500   -0.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5159    3.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5712   -0.9087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4649   -0.9017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6520    2.6236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6406    3.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0802   -0.3506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1194   -0.9505    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6665   -0.3389    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6812   -1.8396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9878   -2.5781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0024   -4.0789    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0471   -4.6694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7001    0.2709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9689   -4.6887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  2  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
  8 13  2  0
  1 13  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
  4 17  2  0
  5 14  2  0
  6 18  2  0
  3 19  1  0
  3 20  1  0
 21 22  1  0
 15 21  1  0
 23 24  3  0
 11 23  1  0
 16 25  1  0
 25 26  1  0
 25 30  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 28 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3746452

    ---

Associated Targets(Human)

ALK Tclin EML4-ALK (350 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 414.55Molecular Weight (Monoisotopic): 414.2420AlogP: 4.47#Rotatable Bonds: 5
Polar Surface Area: 63.13Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.18CX Basic pKa: 8.16CX LogP: 5.10CX LogD: 4.27
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.67Np Likeness Score: -0.08

References

1. Hatcher JM, Bahcall M, Choi HG, Gao Y, Sim T, George R, Jänne PA, Gray NS..  (2015)  Discovery of Inhibitors That Overcome the G1202R Anaplastic Lymphoma Kinase Resistance Mutation.,  58  (23): [PMID:26568289] [10.1021/acs.jmedchem.5b01136]

Source