The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-((2-(Dimethylamino)ethyl)methylamino)-9-ethyl-6,6-dimethyl-11-oxo-6,11-dihydro-5H-benzo[b]carbazole-3-carbonitrile ID: ALA3746452
PubChem CID: 127038286
Max Phase: Preclinical
Molecular Formula: C26H30N4O
Molecular Weight: 414.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCc1cc2c(cc1N(C)CCN(C)C)C(C)(C)c1[nH]c3cc(C#N)ccc3c1C2=O
Standard InChI: InChI=1S/C26H30N4O/c1-7-17-13-19-20(14-22(17)30(6)11-10-29(4)5)26(2,3)25-23(24(19)31)18-9-8-16(15-27)12-21(18)28-25/h8-9,12-14,28H,7,10-11H2,1-6H3
Standard InChI Key: YHTBSIJWBFUQQQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
0.0000 -0.3300 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2600 0.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5200 -0.3300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8000 0.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8000 1.8600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5200 2.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2600 1.8600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2800 1.8600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5200 2.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7800 1.8600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7800 0.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5200 -0.3300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2800 0.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0500 2.5700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3600 1.8600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3600 0.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0500 -0.3600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5159 3.8000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5712 -0.9087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4649 -0.9017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6520 2.6236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6406 3.8235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0802 -0.3506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1194 -0.9505 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6665 -0.3389 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6812 -1.8396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9878 -2.5781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0024 -4.0789 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0471 -4.6694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7001 0.2709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9689 -4.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
2 7 2 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
8 13 2 0
1 13 1 0
14 15 1 0
15 16 2 0
16 17 1 0
4 17 2 0
5 14 2 0
6 18 2 0
3 19 1 0
3 20 1 0
21 22 1 0
15 21 1 0
23 24 3 0
11 23 1 0
16 25 1 0
25 26 1 0
25 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
28 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 414.55Molecular Weight (Monoisotopic): 414.2420AlogP: 4.47#Rotatable Bonds: 5Polar Surface Area: 63.13Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.18CX Basic pKa: 8.16CX LogP: 5.10CX LogD: 4.27Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.67Np Likeness Score: -0.08
References 1. Hatcher JM, Bahcall M, Choi HG, Gao Y, Sim T, George R, Jänne PA, Gray NS.. (2015) Discovery of Inhibitors That Overcome the G1202R Anaplastic Lymphoma Kinase Resistance Mutation., 58 (23): [PMID:26568289 ] [10.1021/acs.jmedchem.5b01136 ]