The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 10-(2-((S)-1-methoxy-4-methyl-1-oxopentan-2-ylamino)-2-oxoethylthio)octadecanoate ID: ALA3746616
PubChem CID: 127037937
Max Phase: Preclinical
Molecular Formula: C28H53NO5S
Molecular Weight: 515.80
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCC(CCCCCCCCC(=O)OC)SCC(=O)N[C@@H](CC(C)C)C(=O)OC
Standard InChI: InChI=1S/C28H53NO5S/c1-6-7-8-9-12-15-18-24(19-16-13-10-11-14-17-20-27(31)33-4)35-22-26(30)29-25(21-23(2)3)28(32)34-5/h23-25H,6-22H2,1-5H3,(H,29,30)/t24?,25-/m0/s1
Standard InChI Key: CPOFZFRDBDAXQY-BBMPLOMVSA-N
Molfile:
RDKit 2D
35 34 0 0 0 0 0 0 0 0999 V2000
0.2606 0.1503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3000 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9000 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5000 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7999 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0999 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3999 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6999 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9999 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2999 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5999 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8999 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1999 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4998 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7998 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0998 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3998 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.4392 0.5997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0998 1.9500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4030 -1.5008 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.7038 -2.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7069 -3.7502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0077 -4.4988 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6687 -4.3520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0108 -5.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3116 -6.7482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3498 -6.1463 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3147 -8.2490 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3548 -8.8475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7139 -6.7549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7187 -8.2558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6817 -8.8597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7600 -8.8521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
18 21 2 0
9 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
25 27 1 0
27 28 1 0
28 29 2 0
28 30 1 0
30 31 1 0
27 32 1 6
32 33 1 0
33 34 1 0
33 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 515.80Molecular Weight (Monoisotopic): 515.3644AlogP: 6.84#Rotatable Bonds: 23Polar Surface Area: 81.70Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.72CX Basic pKa: ┄CX LogP: 7.47CX LogD: 7.47Aromatic Rings: ┄Heavy Atoms: 35QED Weighted: 0.12Np Likeness Score: -0.07
References 1. Kaki SS, Arukali S, Korlipara PV, Prasad RB, Yedla P, Ganesh Kumar C.. (2016) Synthesis and biological evaluation of novel lipoamino acid derivatives., 26 (1): [PMID:26586599 ] [10.1016/j.bmcl.2015.10.086 ]