8-(6-Aminopyridin-3-yl)-9-ethyl-6,6-dimethyl-11-oxo-6,11-dihydro-5H-benzo[b]carbazole-3-carbonitrile

ID: ALA3746626

PubChem CID: 127038285

Max Phase: Preclinical

Molecular Formula: C26H22N4O

Molecular Weight: 406.49

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCc1cc2c(cc1-c1ccc(N)nc1)C(C)(C)c1[nH]c3cc(C#N)ccc3c1C2=O

Standard InChI:  InChI=1S/C26H22N4O/c1-4-15-10-19-20(11-18(15)16-6-8-22(28)29-13-16)26(2,3)25-23(24(19)31)17-7-5-14(12-27)9-21(17)30-25/h5-11,13,30H,4H2,1-3H3,(H2,28,29)

Standard InChI Key:  KYSLRURKVAFCOA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
    0.0000   -0.3300    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2600    0.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5200   -0.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8000    0.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8000    1.8600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5200    2.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2600    1.8600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2800    1.8600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5200    2.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7800    1.8600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7800    0.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5200   -0.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2800    0.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0500    2.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3600    1.8600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3600    0.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0500   -0.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5159    3.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5712   -0.9087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4649   -0.9017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6520    2.6236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6406    3.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0802   -0.3506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1194   -0.9505    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6605   -0.3490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6634   -1.8491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9639   -2.5966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2615   -1.8442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2587   -0.3442    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9582    0.4034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3019   -2.4422    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  2  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
  8 13  2  0
  1 13  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
  4 17  2  0
  5 14  2  0
  6 18  2  0
  3 19  1  0
  3 20  1  0
 21 22  1  0
 15 21  1  0
 23 24  3  0
 11 23  1  0
 16 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 28 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3746626

    ---

Associated Targets(Human)

ALK Tclin EML4-ALK (350 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 406.49Molecular Weight (Monoisotopic): 406.1794AlogP: 5.12#Rotatable Bonds: 2
Polar Surface Area: 95.56Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.16CX Basic pKa: 6.31CX LogP: 5.17CX LogD: 5.13
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.48Np Likeness Score: 0.49

References

1. Hatcher JM, Bahcall M, Choi HG, Gao Y, Sim T, George R, Jänne PA, Gray NS..  (2015)  Discovery of Inhibitors That Overcome the G1202R Anaplastic Lymphoma Kinase Resistance Mutation.,  58  (23): [PMID:26568289] [10.1021/acs.jmedchem.5b01136]

Source