The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-O-caprylyl-2-O-linoleoyl-3-O-(beta-D-glucopyranosyl)-rac-glycerol ID: ALA374827
PubChem CID: 44422382
Max Phase: Preclinical
Molecular Formula: C35H62O10
Molecular Weight: 642.87
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCC/C=C/C/C=C/CCCCCCCC(=O)OC(COC(=O)CCCCCCC)CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
Standard InChI: InChI=1S/C35H62O10/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-20-22-24-31(38)44-28(26-42-30(37)23-21-19-8-6-4-2)27-43-35-34(41)33(40)32(39)29(25-36)45-35/h10-11,13-14,28-29,32-36,39-41H,3-9,12,15-27H2,1-2H3/b11-10+,14-13+/t28?,29-,32-,33+,34-,35-/m1/s1
Standard InChI Key: NGYQMDHCTBNAHL-UQVFBATDSA-N
Molfile:
RDKit 2D
45 45 0 0 1 0 0 0 0 0999 V2000
0.5624 -25.7053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5541 -24.8803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1605 -24.4773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8714 -24.8947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8631 -25.7197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1439 -26.1272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2644 -24.4606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2820 -26.1088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1344 -26.9522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5738 -26.1386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5895 -24.4885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5967 -23.6635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9830 -24.8659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6932 -24.4462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4118 -24.8515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6849 -23.6213 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1221 -24.4318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8407 -24.8371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5510 -24.4174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8490 -25.6620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2696 -24.8226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9798 -24.4030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6984 -24.8082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4087 -24.3885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1273 -24.7938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8376 -24.3741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3952 -23.2016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3869 -22.3766 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1138 -23.6068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8240 -23.1871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5426 -23.5924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2529 -23.1727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9715 -23.5780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6818 -23.1583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4004 -23.5636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1107 -23.1439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8293 -23.5492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5395 -23.1295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2581 -23.5347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9684 -23.1150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6870 -23.5203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3973 -23.1006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1159 -23.5059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8261 -23.0862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5447 -23.4915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 11 1 1
22 23 1 0
4 5 1 0
23 24 1 0
11 12 1 0
24 25 1 0
5 6 1 0
25 26 1 0
7 13 1 0
16 27 1 0
27 28 2 0
13 14 1 0
27 29 1 0
2 7 1 1
29 30 1 0
14 15 1 0
30 31 1 0
1 2 1 0
31 32 1 0
14 16 1 0
32 33 1 0
1 8 1 6
33 34 1 0
15 17 1 0
34 35 1 0
1 6 1 0
35 36 1 0
17 18 1 0
36 37 2 0
6 9 1 1
37 38 1 0
18 19 1 0
38 39 1 0
2 3 1 0
39 40 2 0
18 20 2 0
40 41 1 0
5 10 1 6
41 42 1 0
19 21 1 0
42 43 1 0
3 4 1 0
43 44 1 0
21 22 1 0
44 45 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 642.87Molecular Weight (Monoisotopic): 642.4343AlogP: 5.43#Rotatable Bonds: 27Polar Surface Area: 151.98Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.21CX Basic pKa: ┄CX LogP: 6.84CX LogD: 6.84Aromatic Rings: ┄Heavy Atoms: 45QED Weighted: 0.05Np Likeness Score: 1.37
References 1. Cateni F, Bonivento P, Procida G, Zacchigna M, Gabrielli Favretto L, Scialino G, Banfi E.. (2007) Chemoenzymatic synthesis and antimicrobial activity evaluation of monoglucosyl diglycerides., 15 (2): [PMID:17088068 ] [10.1016/j.bmc.2006.10.045 ]