The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-((4-(4-methoxyphenyl)tetrahydro-2H-pyran-4-yl)methylcarbamoyl)phenyl)-5-methylfuran-2-carboxamide ID: ALA3752054
PubChem CID: 71622125
Max Phase: Preclinical
Molecular Formula: C26H28N2O5
Molecular Weight: 448.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C2(CNC(=O)c3ccc(NC(=O)c4ccc(C)o4)cc3)CCOCC2)cc1
Standard InChI: InChI=1S/C26H28N2O5/c1-18-3-12-23(33-18)25(30)28-21-8-4-19(5-9-21)24(29)27-17-26(13-15-32-16-14-26)20-6-10-22(31-2)11-7-20/h3-12H,13-17H2,1-2H3,(H,27,29)(H,28,30)
Standard InChI Key: UKLWMTAVXDIMIA-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
5.4984 -5.5497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0312 -5.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2447 -3.1359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2484 -4.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5548 -3.6021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6024 2.6977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2003 1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4990 0.7409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7945 -1.4695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7969 0.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1988 0.0347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1965 -1.4653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4943 -2.2174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.8004 1.4893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0981 0.7370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3985 1.4847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.4011 2.9847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1034 3.7370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8030 2.9893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.7006 3.7355 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-11.7010 4.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4419 -4.1252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 1 2 0
3 6 1 0
6 7 1 0
6 8 2 0
7 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
12 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
20 21 1 0
20 24 1 0
21 19 1 0
19 22 1 0
22 23 1 0
23 24 1 0
19 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
31 32 1 0
5 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.52Molecular Weight (Monoisotopic): 448.1998AlogP: 4.33#Rotatable Bonds: 7Polar Surface Area: 89.80Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.18CX LogD: 3.18Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.56Np Likeness Score: -1.33
References 1. Haikarainen T, Waaler J, Ignatev A, Nkizinkiko Y, Venkannagari H, Obaji E, Krauss S, Lehtiö L.. (2016) Development and structural analysis of adenosine site binding tankyrase inhibitors., 26 (2): [PMID:26706174 ] [10.1016/j.bmcl.2015.12.018 ]