The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-{benzyl[2-(dimethylamino)ethyl]sulfamoyl}phenyl)-4-(3-chlorophenyl)piperazine-1-carboxamide ID: ALA3752059
PubChem CID: 127026350
Max Phase: Preclinical
Molecular Formula: C28H34ClN5O3S
Molecular Weight: 556.13
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CCN(Cc1ccccc1)S(=O)(=O)c1ccc(NC(=O)N2CCN(c3cccc(Cl)c3)CC2)cc1
Standard InChI: InChI=1S/C28H34ClN5O3S/c1-31(2)15-20-34(22-23-7-4-3-5-8-23)38(36,37)27-13-11-25(12-14-27)30-28(35)33-18-16-32(17-19-33)26-10-6-9-24(29)21-26/h3-14,21H,15-20,22H2,1-2H3,(H,30,35)
Standard InChI Key: LQOJVFVDIIDILZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6012 3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9015 3.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1993 2.9963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1969 1.4963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8967 0.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6375 -0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8303 -5.4072 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7912 -6.0075 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.8307 -6.6070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4967 -9.7626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1987 -10.5161 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4941 -8.2618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7921 -7.5083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0919 -8.2588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2008 -11.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1583 -9.9182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0928 -9.7596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3907 -10.5115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3886 -12.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0885 -12.7597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7905 -12.0078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7927 -10.5078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4915 -5.2571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1924 -6.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8934 -5.2570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1925 -3.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4915 -3.7571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2352 0.8946 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
4 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
13 14 1 0
14 1 1 0
14 15 2 0
17 16 2 0
18 17 2 0
19 20 1 0
19 21 1 0
21 22 1 0
22 23 1 0
20 24 1 0
20 25 1 0
23 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
22 17 1 0
17 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
35 13 1 0
11 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 556.13Molecular Weight (Monoisotopic): 555.2071AlogP: 4.45#Rotatable Bonds: 9Polar Surface Area: 76.20Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.54CX Basic pKa: 7.54CX LogP: 4.46CX LogD: 4.09Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.42Np Likeness Score: -2.04
References 1. Éliás O, Nógrádi K, Domány G, Szakács Z, Kóti J, Szántay C, Tarcsay Á, Keserű GM, Gere A, Kiss B, Kurkó D, Kolok S, Némethy Z, Kapui Z, Hellinger É, Vastag M, Sághy K, Kedves R, Gyertyán I.. (2016) The influence of 5-HT(2A) activity on a 5-HT(2C) specific in vivo assay used for early identification of multiple acting SERT and 5-HT(2C) receptor ligands., 26 (3): [PMID:26748694 ] [10.1016/j.bmcl.2015.12.071 ]