The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2,2-dichloroacetamido)-N,N-bis(2-(2,2-dichloroacetamido)ethyl)-N-methylethanaminium trifluoroacetate ID: ALA3752113
PubChem CID: 127037426
Max Phase: Preclinical
Molecular Formula: C15H21Cl6F3N4O5
Molecular Weight: 494.05
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[N+](CCNC(=O)C(Cl)Cl)(CCNC(=O)C(Cl)Cl)CCNC(=O)C(Cl)Cl.O=C([O-])C(F)(F)F
Standard InChI: InChI=1S/C13H20Cl6N4O3.C2HF3O2/c1-23(5-2-20-11(24)8(14)15,6-3-21-12(25)9(16)17)7-4-22-13(26)10(18)19;3-2(4,5)1(6)7/h8-10H,2-7H2,1H3,(H2-,20,21,22,24,25,26);(H,6,7)
Standard InChI Key: QXEAVDNMVGHPCV-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 31 0 0 0 0 0 0 0 0999 V2000
20.6999 -2.6277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3999 -1.8777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3604 -2.4773 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.3999 -0.6777 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.3607 -1.2775 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.6999 -3.8277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7393 -2.0280 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3999 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0999 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7999 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5000 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9000 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3000 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2606 0.1503 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.3000 1.9500 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.6000 -1.2000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7999 -1.5007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5007 -2.2520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5007 -3.7528 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2014 -4.5040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1620 -3.9044 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2014 -6.0049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1625 -6.6055 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.2408 -6.6045 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
7.7999 1.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6999 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9999 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2999 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3393 0.1503 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
14.2999 1.9500 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.9999 -1.2000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
2 5 1 0
1 6 1 0
1 7 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
15 17 1 0
14 18 2 0
10 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
24 26 1 0
10 27 1 0
8 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
30 32 1 0
29 33 2 0
M CHG 2 6 -1 10 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.05Molecular Weight (Monoisotopic): 490.9739AlogP: 1.19#Rotatable Bonds: 12Polar Surface Area: 87.30Molecular Species: NEUTRALHBA: 3HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.67CX Basic pKa: ┄CX LogP: -3.06CX LogD: -1.38Aromatic Rings: ┄Heavy Atoms: 26QED Weighted: 0.28Np Likeness Score: 0.04
References 1. Trapella C, Voltan R, Melloni E, Tisato V, Celeghini C, Bianco S, Fantinati A, Salvadori S, Guerrini R, Secchiero P, Zauli G.. (2016) Design, Synthesis, and Biological Characterization of Novel Mitochondria Targeted Dichloroacetate-Loaded Compounds with Antileukemic Activity., 59 (1): [PMID:26653539 ] [10.1021/acs.jmedchem.5b01165 ]