The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-chloro-N-(4-(3-(dimethylamino)-1-phenylpropoxy)phenyl)-5-methylindoline-1-carboxamide ID: ALA3752465
PubChem CID: 127027606
Max Phase: Preclinical
Molecular Formula: C27H30ClN3O2
Molecular Weight: 464.01
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc2c(cc1Cl)N(C(=O)Nc1ccc(OC(CCN(C)C)c3ccccc3)cc1)CC2
Standard InChI: InChI=1S/C27H30ClN3O2/c1-19-17-21-13-16-31(25(21)18-24(19)28)27(32)29-22-9-11-23(12-10-22)33-26(14-15-30(2)3)20-7-5-4-6-8-20/h4-12,17-18,26H,13-16H2,1-3H3,(H,29,32)
Standard InChI Key: LEZYBQCQNUONFW-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
5.9233 -14.0282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9278 -12.9142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4653 -11.4873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9984 -11.1742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9938 -12.2883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4563 -13.7152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5316 -9.7478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5330 -8.6298 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0635 -9.4362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5984 -8.0093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1302 -7.6977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7583 -6.5568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3278 -8.5900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0663 -7.2034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0655 -6.0846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5962 -4.6599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1277 -4.3539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1285 -5.4728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5978 -6.8975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6552 -2.9294 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1855 -2.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3877 -3.5218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3560 -1.3452 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.3560 1.3452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
7 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
11 13 1 0
8 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
17 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
22 24 1 0
24 25 1 0
25 27 1 0
26 22 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
30 32 1 0
29 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.01Molecular Weight (Monoisotopic): 463.2027AlogP: 6.31#Rotatable Bonds: 7Polar Surface Area: 44.81Molecular Species: BASEHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.09CX Basic pKa: 9.05CX LogP: 5.85CX LogD: 4.19Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.45Np Likeness Score: -1.22
References 1. Éliás O, Nógrádi K, Domány G, Szakács Z, Kóti J, Szántay C, Tarcsay Á, Keserű GM, Gere A, Kiss B, Kurkó D, Kolok S, Némethy Z, Kapui Z, Hellinger É, Vastag M, Sághy K, Kedves R, Gyertyán I.. (2016) The influence of 5-HT(2A) activity on a 5-HT(2C) specific in vivo assay used for early identification of multiple acting SERT and 5-HT(2C) receptor ligands., 26 (3): [PMID:26748694 ] [10.1016/j.bmcl.2015.12.071 ]