(R)-N-[(5-Methylsulfonyl-1H-indol-2-yl)methyl]-1-(1-naphthyl)ethanamine

ID: ALA3752605

PubChem CID: 57385842

Max Phase: Preclinical

Molecular Formula: C22H22N2O2S

Molecular Weight: 378.50

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H](NCc1cc2cc(S(C)(=O)=O)ccc2[nH]1)c1cccc2ccccc12

Standard InChI:  InChI=1S/C22H22N2O2S/c1-15(20-9-5-7-16-6-3-4-8-21(16)20)23-14-18-12-17-13-19(27(2,25)26)10-11-22(17)24-18/h3-13,15,23-24H,14H2,1-2H3/t15-/m1/s1

Standard InChI Key:  FHWXNNHLLAGJTK-OAHLLOKOSA-N

Molfile:  

     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   -1.2896    2.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3263    3.6026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0131    3.7434    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0200    5.2442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4761    7.4707    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3227    5.9895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6465    5.3679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6674    6.4577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1709    6.4182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9455    7.7257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2184    9.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6990    9.0627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9403    7.7640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4462    7.7121    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.0551    8.7462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0376    6.6680    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6462    7.7020    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  1
  1  3  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
  4 13  2  0
  8 13  1  0
  1  4  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 15 23  1  0
 18 23  2  0
 14 16  1  0
  3 14  1  0
 20 24  1  0
 24 25  1  0
 24 26  2  0
 27 24  2  0
M  END

Associated Targets(non-human)

Casr Calcium sensing receptor (198 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 378.50Molecular Weight (Monoisotopic): 378.1402AlogP: 4.58#Rotatable Bonds: 5
Polar Surface Area: 61.96Molecular Species: BASEHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.62CX LogP: 3.52CX LogD: 2.28
Aromatic Rings: 4Heavy Atoms: 27QED Weighted: 0.53Np Likeness Score: -1.29

References

1. Kiefer L, Beaumard F, Gorojankina T, Faure H, Ruat M, Dodd RH..  (2016)  Design and synthesis of calindol derivatives as potent and selective calcium sensing receptor agonists.,  24  (4): [PMID:26752095] [10.1016/j.bmc.2015.12.019]

Source