The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(N-benzyl-N-(2-(dimethylamino)ethyl)sulfamoyl)phenyl)-6-chloro-5-methylindoline-1-carboxamide ID: ALA3753075
PubChem CID: 127029489
Max Phase: Preclinical
Molecular Formula: C27H31ClN4O3S
Molecular Weight: 527.09
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc2c(cc1Cl)N(C(=O)Nc1ccc(S(=O)(=O)N(CCN(C)C)Cc3ccccc3)cc1)CC2
Standard InChI: InChI=1S/C27H31ClN4O3S/c1-20-17-22-13-14-32(26(22)18-25(20)28)27(33)29-23-9-11-24(12-10-23)36(34,35)31(16-15-30(2)3)19-21-7-5-4-6-8-21/h4-12,17-18H,13-16,19H2,1-3H3,(H,29,33)
Standard InChI Key: GEPAZHSJKGQJML-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3560 -1.3452 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.6552 -2.9294 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1855 -2.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3877 -3.5218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7363 -9.5236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5359 -8.6289 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.9108 -9.7688 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4761 -8.1275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4785 -7.0105 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0073 -7.8188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0050 -8.9359 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4745 -10.3613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6528 -7.2572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1054 -5.8699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9436 -10.6684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4150 -12.0924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8839 -12.3963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8815 -11.2761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4102 -9.8520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9413 -9.5482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0663 -7.2034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0655 -6.0846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5962 -4.6599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1277 -4.3539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1285 -5.4728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5978 -6.8975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3560 1.3452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 5 1 0
4 1 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
8 10 1 0
11 12 1 0
12 1 1 0
12 13 2 0
15 14 2 0
16 15 2 0
17 18 1 0
17 19 1 0
19 20 1 0
20 21 1 0
18 22 1 0
18 23 1 0
21 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
20 15 1 0
15 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
33 11 1 0
7 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 527.09Molecular Weight (Monoisotopic): 526.1805AlogP: 5.00#Rotatable Bonds: 8Polar Surface Area: 72.96Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.15CX Basic pKa: 7.54CX LogP: 4.94CX LogD: 4.56Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.45Np Likeness Score: -1.85
References 1. Éliás O, Nógrádi K, Domány G, Szakács Z, Kóti J, Szántay C, Tarcsay Á, Keserű GM, Gere A, Kiss B, Kurkó D, Kolok S, Némethy Z, Kapui Z, Hellinger É, Vastag M, Sághy K, Kedves R, Gyertyán I.. (2016) The influence of 5-HT(2A) activity on a 5-HT(2C) specific in vivo assay used for early identification of multiple acting SERT and 5-HT(2C) receptor ligands., 26 (3): [PMID:26748694 ] [10.1016/j.bmcl.2015.12.071 ]