(R)-N-[(5-Benzyloxy-1H-indol-2-yl)methyl]-1-(1-naphthyl)ethanamine

ID: ALA3753240

PubChem CID: 57385591

Max Phase: Preclinical

Molecular Formula: C28H26N2O

Molecular Weight: 406.53

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H](NCc1cc2cc(OCc3ccccc3)ccc2[nH]1)c1cccc2ccccc12

Standard InChI:  InChI=1S/C28H26N2O/c1-20(26-13-7-11-22-10-5-6-12-27(22)26)29-18-24-16-23-17-25(14-15-28(23)30-24)31-19-21-8-3-2-4-9-21/h2-17,20,29-30H,18-19H2,1H3/t20-/m1/s1

Standard InChI Key:  ALQXJYXDVNQDJH-HXUWFJFHSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   -1.2896    2.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3263    3.6026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0131    3.7434    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0200    5.2442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4761    7.4707    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3227    5.9895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6465    5.3679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6674    6.4577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1709    6.4182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9455    7.7257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2184    9.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6990    9.0627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9403    7.7640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4462    7.7152    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2064    9.0093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7072    8.9990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4688   10.2913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9687   10.2779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7071    8.9723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9456    7.6800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4457    7.6933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  1
  1  3  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
  4 13  2  0
  8 13  1  0
  1  4  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 15 23  1  0
 18 23  2  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 26 31  2  0
 24 25  1  0
 20 24  1  0
 14 16  1  0
  3 14  1  0
M  END

Associated Targets(non-human)

Casr Calcium sensing receptor (198 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 406.53Molecular Weight (Monoisotopic): 406.2045AlogP: 6.75#Rotatable Bonds: 7
Polar Surface Area: 37.05Molecular Species: BASEHBA: 2HBD: 2
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.89CX LogP: 6.25CX LogD: 4.75
Aromatic Rings: 5Heavy Atoms: 31QED Weighted: 0.31Np Likeness Score: -0.83

References

1. Kiefer L, Beaumard F, Gorojankina T, Faure H, Ruat M, Dodd RH..  (2016)  Design and synthesis of calindol derivatives as potent and selective calcium sensing receptor agonists.,  24  (4): [PMID:26752095] [10.1016/j.bmc.2015.12.019]

Source