N-benzyl-4-[4-(3-chlorophenyl)piperazine-1-carbonyl]-N-[2-(dimethylamino)ethyl]benzene-1-sulfonamide

ID: ALA3753283

PubChem CID: 127026351

Max Phase: Preclinical

Molecular Formula: C28H33ClN4O3S

Molecular Weight: 541.12

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)CCN(Cc1ccccc1)S(=O)(=O)c1ccc(C(=O)N2CCN(c3cccc(Cl)c3)CC2)cc1

Standard InChI:  InChI=1S/C28H33ClN4O3S/c1-30(2)15-20-33(22-23-7-4-3-5-8-23)37(35,36)27-13-11-24(12-14-27)28(34)32-18-16-31(17-19-32)26-10-6-9-25(29)21-26/h3-14,21H,15-20,22H2,1-2H3

Standard InChI Key:  IIPLNNXKJLLFCH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
    1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5987    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6012    3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9015    3.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1993    2.9963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1969    1.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8967    0.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2352    0.8946    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.5381   -8.1009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5795   -7.5048    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.5748   -8.7048    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4762   -8.2749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7803   -7.5320    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1803   -7.5177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8762   -8.2605    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8710   -9.7613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8164   -8.1374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7869   -6.3321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1677  -10.5171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1647  -12.0171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4622  -12.7698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7628  -12.0224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7659  -10.5224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4684   -9.7698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5847   -6.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8864   -5.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8915   -3.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2935   -3.7495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2883   -5.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6375   -0.9049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  4  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 11 13  1  0
 15 14  2  0
 16 15  2  0
 17 18  1  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 18 22  1  0
 18 23  1  0
 21 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 20 15  1  0
 15 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 33 36  1  0
 36 37  2  0
 36  1  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3753283

    ---

Associated Targets(non-human)

Htr2c Serotonin 2c (5-HT2c) receptor (1134 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Slc6a4 Serotonin transporter (6087 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 541.12Molecular Weight (Monoisotopic): 540.1962AlogP: 4.05#Rotatable Bonds: 9
Polar Surface Area: 64.17Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.54CX LogP: 4.41CX LogD: 4.03
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.41Np Likeness Score: -1.88

References

1. Éliás O, Nógrádi K, Domány G, Szakács Z, Kóti J, Szántay C, Tarcsay Á, Keserű GM, Gere A, Kiss B, Kurkó D, Kolok S, Némethy Z, Kapui Z, Hellinger É, Vastag M, Sághy K, Kedves R, Gyertyán I..  (2016)  The influence of 5-HT(2A) activity on a 5-HT(2C) specific in vivo assay used for early identification of multiple acting SERT and 5-HT(2C) receptor ligands.,  26  (3): [PMID:26748694] [10.1016/j.bmcl.2015.12.071]

Source